(1R,2R,4S)-1-[(E,3R)-3-hydroxybut-1-enyl]-2,6,6-trimethyl-7-oxabicyclo[2.2.1]heptan-2-ol
| Internal ID | f61a941a-e2e0-4f80-97f0-cd66badc1cf5 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Monosaccharides |
| IUPAC Name | (1R,2R,4S)-1-[(E,3R)-3-hydroxybut-1-enyl]-2,6,6-trimethyl-7-oxabicyclo[2.2.1]heptan-2-ol |
| SMILES (Canonical) | CC(C=CC12C(CC(O1)CC2(C)O)(C)C)O |
| SMILES (Isomeric) | C[C@H](/C=C/[C@@]12[C@](C[C@@H](O1)CC2(C)C)(C)O)O |
| InChI | InChI=1S/C13H22O3/c1-9(14)5-6-13-11(2,3)7-10(16-13)8-12(13,4)15/h5-6,9-10,14-15H,7-8H2,1-4H3/b6-5+/t9-,10+,12-,13-/m1/s1 |
| InChI Key | MGKALPYWYBAWNU-HCSJXBKUSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.15689456 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | 1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.19% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.91% | 85.14% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.36% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.41% | 91.11% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.81% | 92.86% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.01% | 93.10% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.96% | 97.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.90% | 94.75% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.41% | 95.89% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 81.11% | 98.03% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 81.05% | 95.58% |
| CHEMBL236 | P41143 | Delta opioid receptor | 80.46% | 99.35% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.38% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Capsicum annuum |
| Nicotiana tabacum |
| PubChem | 162904663 |
| LOTUS | LTS0059698 |
| wikiData | Q105163368 |