(1R,2R,3S,10S)-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-14-en-11-one
Internal ID | bcfa81ec-ac1f-4f95-aa35-4446172fceb4 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | (1R,2R,3S,10S)-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-14-en-11-one |
SMILES (Canonical) | CC1=CC2CC(=O)C3CCCN4C3(C1)C2C(CC4)O |
SMILES (Isomeric) | CC1=CC2CC(=O)[C@H]3CCCN4[C@]3(C1)[C@@H]2[C@H](CC4)O |
InChI | InChI=1S/C16H23NO2/c1-10-7-11-8-14(19)12-3-2-5-17-6-4-13(18)15(11)16(12,17)9-10/h7,11-13,15,18H,2-6,8-9H2,1H3/t11?,12-,13+,15+,16+/m1/s1 |
InChI Key | FZGDQIGQCRVQQL-LHXXSIHOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H23NO2 |
Molecular Weight | 261.36 g/mol |
Exact Mass | 261.172878976 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 0.80 |
There are no found synonyms. |
![2D Structure of (1R,2R,3S,10S)-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-14-en-11-one 2D Structure of (1R,2R,3S,10S)-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-14-en-11-one](https://plantaedb.com/storage/docs/compounds/2023/11/1r2r3s10s-3-hydroxy-15-methyl-6-azatetracyclo8600160213hexadec-14-en-11-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.13% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 95.99% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.15% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.40% | 95.89% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.25% | 93.03% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 89.20% | 93.04% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.71% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.60% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.41% | 92.94% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.34% | 90.00% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 82.04% | 94.78% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.89% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.35% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.62% | 93.00% |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 80.47% | 91.76% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Huperzia serrata |
PubChem | 163187989 |
LOTUS | LTS0121846 |
wikiData | Q105004925 |