(1R,2R,13R,15R)-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadeca-7,9-diene-11,12-dione
| Internal ID | e398bdfc-83d4-49a1-a583-f656700a2376 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1R,2R,13R,15R)-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadeca-7,9-diene-11,12-dione |
| SMILES (Canonical) | CC1CC2C3CCCN4C3(C1)C(=CC=C4)C(=O)C2=O |
| SMILES (Isomeric) | C[C@@H]1C[C@@H]2[C@H]3CCCN4[C@@]3(C1)C(=CC=C4)C(=O)C2=O |
| InChI | InChI=1S/C16H19NO2/c1-10-8-11-12-4-2-6-17-7-3-5-13(15(19)14(11)18)16(12,17)9-10/h3,5,7,10-12H,2,4,6,8-9H2,1H3/t10-,11-,12-,16-/m1/s1 |
| InChI Key | PQFLDIFCQXFBIF-DSZLRUIBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.141578849 g/mol |
| Topological Polar Surface Area (TPSA) | 37.40 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
![2D Structure of (1R,2R,13R,15R)-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadeca-7,9-diene-11,12-dione](https://plantaedb.com/storage/docs/compounds/2023/11/1r2r13r15r-15-methyl-6-azatetracyclo8600160213hexadeca-79-diene-1112-dione.jpg "2D Structure of (1R,2R,13R,15R)-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadeca-7,9-diene-11,12-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.67% | 97.25% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 95.64% | 93.40% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.79% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.72% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.85% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.78% | 100.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.20% | 93.04% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 86.38% | 95.27% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 86.06% | 94.66% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.81% | 98.95% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 85.36% | 99.29% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.33% | 95.89% |
| CHEMBL1871 | P10275 | Androgen Receptor | 85.24% | 96.43% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.22% | 99.23% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 83.78% | 99.18% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.73% | 82.69% |
| CHEMBL2916 | O14746 | Telomerase reverse transcriptase | 82.37% | 90.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.83% | 91.11% |
| CHEMBL238 | Q01959 | Dopamine transporter | 81.34% | 95.88% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.32% | 95.50% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.87% | 94.78% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 80.77% | 94.50% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.60% | 90.24% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.56% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Huperzia serrata |
| PubChem | 163050596 |
| LOTUS | LTS0213636 |
| wikiData | Q105213207 |