(1R,2R,13R,15R)-11-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadeca-8,10-dien-12-one
Internal ID | a1650713-8eab-45b0-bde1-92ccc7f16673 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | (1R,2R,13R,15R)-11-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadeca-8,10-dien-12-one |
SMILES (Canonical) | CC1CC2C3CCCN4C3(C1)C(=C(C2=O)O)C=CC4 |
SMILES (Isomeric) | C[C@@H]1C[C@@H]2[C@H]3CCCN4[C@@]3(C1)C(=C(C2=O)O)C=CC4 |
InChI | InChI=1S/C16H21NO2/c1-10-8-11-12-4-2-6-17-7-3-5-13(15(19)14(11)18)16(12,17)9-10/h3,5,10-12,19H,2,4,6-9H2,1H3/t10-,11-,12-,16-/m1/s1 |
InChI Key | IRBNEBXOQHDOSE-DSZLRUIBSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C16H21NO2 |
Molecular Weight | 259.34 g/mol |
Exact Mass | 259.157228913 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 1.80 |
There are no found synonyms. |
![2D Structure of (1R,2R,13R,15R)-11-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadeca-8,10-dien-12-one 2D Structure of (1R,2R,13R,15R)-11-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadeca-8,10-dien-12-one](https://plantaedb.com/storage/docs/compounds/2023/11/1r2r13r15r-11-hydroxy-15-methyl-6-azatetracyclo8600160213hexadeca-810-dien-12-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.56% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.20% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.19% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.02% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.47% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 89.16% | 98.95% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.15% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.06% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.39% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.11% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.73% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.69% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.60% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.49% | 89.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.93% | 96.43% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.50% | 93.04% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.27% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Huperzia serrata |
PubChem | 127052893 |
LOTUS | LTS0058913 |
wikiData | Q105118752 |