(1R,2R,13R,15R)-11-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-10-en-12-one
Internal ID | 5d160f5d-6ba0-4dfa-a019-53d3d03ebe52 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | (1R,2R,13R,15R)-11-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-10-en-12-one |
SMILES (Canonical) | CC1CC2C3CCCN4C3(C1)C(=C(C2=O)O)CCC4 |
SMILES (Isomeric) | C[C@@H]1C[C@@H]2[C@H]3CCCN4[C@@]3(C1)C(=C(C2=O)O)CCC4 |
InChI | InChI=1S/C16H23NO2/c1-10-8-11-12-4-2-6-17-7-3-5-13(15(19)14(11)18)16(12,17)9-10/h10-12,19H,2-9H2,1H3/t10-,11-,12-,16-/m1/s1 |
InChI Key | WGDYIUPOJSCTTE-DSZLRUIBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H23NO2 |
Molecular Weight | 261.36 g/mol |
Exact Mass | 261.172878976 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 1.80 |
There are no found synonyms. |
![2D Structure of (1R,2R,13R,15R)-11-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-10-en-12-one 2D Structure of (1R,2R,13R,15R)-11-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-10-en-12-one](https://plantaedb.com/storage/docs/compounds/2023/11/1r2r13r15r-11-hydroxy-15-methyl-6-azatetracyclo8600160213hexadec-10-en-12-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.14% | 97.25% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.03% | 93.40% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.84% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.03% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.01% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.75% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.31% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 88.10% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.05% | 99.23% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.68% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.02% | 95.89% |
CHEMBL1871 | P10275 | Androgen Receptor | 85.01% | 96.43% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 84.47% | 99.18% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.75% | 82.69% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.12% | 100.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.17% | 93.04% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.62% | 90.71% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.26% | 94.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Huperzia serrata |
PubChem | 162887652 |
LOTUS | LTS0209764 |
wikiData | Q105304419 |