(1R,2R,10S,11S,12S,13S)-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-14-ene-11,12-diol
Internal ID | ca5dbead-59a3-4a53-b804-0d6779aac70a |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | (1R,2R,10S,11S,12S,13S)-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-14-ene-11,12-diol |
SMILES (Canonical) | CC1=CC2C3CCCN4C3(C1)C(CCC4)C(C2O)O |
SMILES (Isomeric) | CC1=C[C@H]2[C@H]3CCCN4[C@@]3(C1)[C@H](CCC4)[C@@H]([C@H]2O)O |
InChI | InChI=1S/C16H25NO2/c1-10-8-11-12-4-2-6-17-7-3-5-13(15(19)14(11)18)16(12,17)9-10/h8,11-15,18-19H,2-7,9H2,1H3/t11-,12+,13+,14-,15-,16+/m0/s1 |
InChI Key | QNTZOBVSDAZRHK-CIUQCDBWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H25NO2 |
Molecular Weight | 263.37 g/mol |
Exact Mass | 263.188529040 g/mol |
Topological Polar Surface Area (TPSA) | 43.70 Ų |
XlogP | 1.00 |
There are no found synonyms. |
![2D Structure of (1R,2R,10S,11S,12S,13S)-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-14-ene-11,12-diol 2D Structure of (1R,2R,10S,11S,12S,13S)-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-14-ene-11,12-diol](https://plantaedb.com/storage/docs/compounds/2023/11/1r2r10s11s12s13s-15-methyl-6-azatetracyclo8600160213hexadec-14-ene-1112-diol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.89% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.61% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.32% | 97.25% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.03% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 89.01% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.58% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.44% | 97.09% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 83.34% | 94.78% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.67% | 93.04% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.59% | 95.56% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.45% | 93.03% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.25% | 92.94% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.51% | 90.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.06% | 85.14% |
CHEMBL4072 | P07858 | Cathepsin B | 80.11% | 93.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Huperzia serrata |
PubChem | 21457176 |
LOTUS | LTS0121490 |
wikiData | Q105224652 |