(1R,2R,10S,11S,12S,13R,15R)-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecane-11,12-diol
Internal ID | 94e0786e-cdd5-4193-a9dd-e778b10256eb |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | (1R,2R,10S,11S,12S,13R,15R)-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecane-11,12-diol |
SMILES (Canonical) | CC1CC2C3CCCN4C3(C1)C(CCC4)C(C2O)O |
SMILES (Isomeric) | C[C@@H]1C[C@@H]2[C@H]3CCCN4[C@@]3(C1)[C@H](CCC4)[C@@H]([C@H]2O)O |
InChI | InChI=1S/C16H27NO2/c1-10-8-11-12-4-2-6-17-7-3-5-13(15(19)14(11)18)16(12,17)9-10/h10-15,18-19H,2-9H2,1H3/t10-,11-,12-,13-,14+,15+,16-/m1/s1 |
InChI Key | OCUUNZFHCCKHPB-OTFNZQRDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H27NO2 |
Molecular Weight | 265.39 g/mol |
Exact Mass | 265.204179104 g/mol |
Topological Polar Surface Area (TPSA) | 43.70 Ų |
XlogP | 1.70 |
There are no found synonyms. |
![2D Structure of (1R,2R,10S,11S,12S,13R,15R)-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecane-11,12-diol 2D Structure of (1R,2R,10S,11S,12S,13R,15R)-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecane-11,12-diol](https://plantaedb.com/storage/docs/compounds/2023/11/1r2r10s11s12s13r15r-15-methyl-6-azatetracyclo8600160213hexadecane-1112-diol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.32% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.40% | 97.25% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.03% | 85.14% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 93.88% | 95.58% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 91.56% | 94.78% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.66% | 97.09% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 88.64% | 97.64% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.58% | 100.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.97% | 96.38% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.66% | 92.94% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.30% | 91.03% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 84.92% | 98.33% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.87% | 90.24% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 82.30% | 90.71% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.26% | 99.18% |
CHEMBL238 | Q01959 | Dopamine transporter | 82.08% | 95.88% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.07% | 96.43% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.78% | 95.50% |
CHEMBL237 | P41145 | Kappa opioid receptor | 81.54% | 98.10% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 81.49% | 98.99% |
CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 81.38% | 97.56% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.03% | 95.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.88% | 95.89% |
CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 80.63% | 95.27% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Huperzia serrata |
Lycopodium lagopus |
PubChem | 14589222 |
LOTUS | LTS0187932 |
wikiData | Q105189604 |