(1R,2E,4S,6E,10S)-3,7-dimethyl-10-[(2R)-6-methylhept-5-en-2-yl]cyclodeca-2,6-diene-1,4-diol
| Internal ID | 9a64d33c-23d6-415e-b49e-a1e4561257cc |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | (1R,2E,4S,6E,10S)-3,7-dimethyl-10-[(2R)-6-methylhept-5-en-2-yl]cyclodeca-2,6-diene-1,4-diol |
| SMILES (Canonical) | CC1=CCC(C(=CC(C(CC1)C(C)CCC=C(C)C)O)C)O |
| SMILES (Isomeric) | C/C/1=C\C[C@@H](/C(=C/[C@@H]([C@@H](CC1)[C@H](C)CCC=C(C)C)O)/C)O |
| InChI | InChI=1S/C20H34O2/c1-14(2)7-6-8-16(4)18-11-9-15(3)10-12-19(21)17(5)13-20(18)22/h7,10,13,16,18-22H,6,8-9,11-12H2,1-5H3/b15-10+,17-13+/t16-,18+,19+,20+/m1/s1 |
| InChI Key | OXWXNRAARMNGON-YPCCVXNOSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.255880323 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
![2D Structure of (1R,2E,4S,6E,10S)-3,7-dimethyl-10-[(2R)-6-methylhept-5-en-2-yl]cyclodeca-2,6-diene-1,4-diol](https://plantaedb.com/storage/docs/compounds/2023/11/1r2e4s6e10s-37-dimethyl-10-2r-6-methylhept-5-en-2-ylcyclodeca-26-diene-14-diol.jpg "2D Structure of (1R,2E,4S,6E,10S)-3,7-dimethyl-10-[(2R)-6-methylhept-5-en-2-yl]cyclodeca-2,6-diene-1,4-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 91.98% | 98.95% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.65% | 93.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.59% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.80% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.21% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.39% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.66% | 95.89% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.74% | 96.47% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.39% | 97.09% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 82.45% | 97.47% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.39% | 97.25% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.97% | 93.03% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.82% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.71% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 15715159 |
| LOTUS | LTS0080417 |
| wikiData | Q105203013 |