(1R,2E,4R,7E,11E)-1,7,11-trimethyl-4-propan-2-ylcyclotetradeca-2,7,11-trien-1-ol
Internal ID | d4cafa33-0d7c-413d-8f72-f508d958f69e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Cembrane diterpenoids |
IUPAC Name | (1R,2E,4R,7E,11E)-1,7,11-trimethyl-4-propan-2-ylcyclotetradeca-2,7,11-trien-1-ol |
SMILES (Canonical) | CC1=CCCC(C=CC(CCC(=CCC1)C)C(C)C)(C)O |
SMILES (Isomeric) | C/C/1=C\CC[C@@](/C=C/[C@H](CC/C(=C/CC1)/C)C(C)C)(C)O |
InChI | InChI=1S/C20H34O/c1-16(2)19-12-11-18(4)9-6-8-17(3)10-7-14-20(5,21)15-13-19/h9-10,13,15-16,19,21H,6-8,11-12,14H2,1-5H3/b15-13+,17-10+,18-9+/t19-,20+/m0/s1 |
InChI Key | YAPXSYXFLHDPCK-MXUGJEEPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H34O |
Molecular Weight | 290.50 g/mol |
Exact Mass | 290.260965704 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 5.10 |
25269-17-4 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.28% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.98% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.91% | 91.11% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.66% | 96.61% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.53% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.29% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.45% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.00% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.04% | 94.75% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.85% | 93.99% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.23% | 91.49% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.39% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 81.24% | 98.95% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.33% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nicotiana sylvestris |
PubChem | 12444348 |
LOTUS | LTS0232883 |
wikiData | Q105345505 |