(1R,20R)-1,3,11,12,14,17,18,19,20,21-decahydroyohimban
| Internal ID | 7848545d-1594-45e4-af0e-a125d6dda111 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
| IUPAC Name | (1R,20R)-1,3,11,12,14,17,18,19,20,21-decahydroyohimban |
| SMILES (Canonical) | C1CC=C2CN3CCC4=C(C3CC2C1)NC5=CC=CC=C45 |
| SMILES (Isomeric) | C1CC=C2CN3CCC4=C([C@H]3C[C@H]2C1)NC5=CC=CC=C45 |
| InChI | InChI=1S/C19H22N2/c1-2-6-14-12-21-10-9-16-15-7-3-4-8-17(15)20-19(16)18(21)11-13(14)5-1/h3-4,6-8,13,18,20H,1-2,5,9-12H2/t13-,18-/m1/s1 |
| InChI Key | ILWYXIUNTQZXOW-FZKQIMNGSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.178298710 g/mol |
| Topological Polar Surface Area (TPSA) | 19.00 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL240 | Q12809 | HERG | 97.96% | 89.76% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 95.62% | 93.40% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.22% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.45% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.90% | 96.09% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 91.37% | 90.71% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.02% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.53% | 94.45% |
| CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 90.53% | 96.42% |
| CHEMBL4599 | Q07912 | Tyrosine kinase non-receptor protein 2 | 90.02% | 94.29% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 89.91% | 91.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.47% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.27% | 98.95% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 88.52% | 88.56% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 84.78% | 91.76% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 82.98% | 91.79% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.89% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.84% | 95.89% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 82.56% | 97.64% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 82.28% | 95.00% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 82.27% | 91.43% |
| CHEMBL228 | P31645 | Serotonin transporter | 82.19% | 95.51% |
| CHEMBL2189110 | Q15910 | Histone-lysine N-methyltransferase EZH2 | 81.95% | 97.50% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.24% | 95.83% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 81.16% | 95.62% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 81.13% | 96.31% |
| CHEMBL5028 | O14672 | ADAM10 | 80.81% | 97.50% |
| CHEMBL1991 | O14920 | Inhibitor of nuclear factor kappa B kinase beta subunit | 80.81% | 97.15% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 80.74% | 92.98% |
| CHEMBL5493 | O15552 | Free fatty acid receptor 2 | 80.09% | 92.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Strychnos johnsonii |
| PubChem | 163195194 |
| LOTUS | LTS0163909 |
| wikiData | Q105115522 |