(1R)-7-methoxy-1,6-dimethyl-4-propan-2-yl-1,2-dihydronaphthalene
| Internal ID | 031fdbfe-0aec-47d6-8ea9-dcb8bcde7a85 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1R)-7-methoxy-1,6-dimethyl-4-propan-2-yl-1,2-dihydronaphthalene |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H22O/c1-10(2)13-7-6-11(3)14-9-16(17-5)12(4)8-15(13)14/h7-11H,6H2,1-5H3/t11-/m1/s1 |
| InChI Key | VMTKGTHHOWQTRO-LLVKDONJSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.167065321 g/mol |
| Topological Polar Surface Area (TPSA) | 9.20 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.62% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.86% | 98.95% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.04% | 89.62% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.57% | 93.31% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.35% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.23% | 98.75% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 85.85% | 92.98% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.83% | 95.89% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.50% | 97.21% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.79% | 86.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.78% | 97.14% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.60% | 90.71% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.54% | 90.24% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.28% | 97.09% |
| CHEMBL4444 | P04070 | Vitamin K-dependent protein C | 82.27% | 93.89% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.16% | 91.11% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.11% | 99.18% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.09% | 99.15% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.99% | 93.18% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 81.39% | 97.23% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.29% | 90.24% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.96% | 93.56% |
| CHEMBL2337 | P48067 | Glycine transporter 1 | 80.14% | 95.45% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.09% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162910132 |
| LOTUS | LTS0134720 |
| wikiData | Q105289283 |