(1R)-6-methoxy-1-[(4-methoxyphenyl)methyl]-1,2-dihydronaphthalene
| Internal ID | 15f583f3-189f-48e4-be2c-7e5ddd666607 |
| Taxonomy | Lignans, neolignans and related compounds |
| IUPAC Name | (1R)-6-methoxy-1-[(4-methoxyphenyl)methyl]-1,2-dihydronaphthalene |
| SMILES (Canonical) | COC1=CC=C(C=C1)CC2CC=CC3=C2C=CC(=C3)OC |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C[C@H]2CC=CC3=C2C=CC(=C3)OC |
| InChI | InChI=1S/C19H20O2/c1-20-17-8-6-14(7-9-17)12-15-4-3-5-16-13-18(21-2)10-11-19(15)16/h3,5-11,13,15H,4,12H2,1-2H3/t15-/m1/s1 |
| InChI Key | CGHDUZWRAYYDQB-OAHLLOKOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.146329876 g/mol |
| Topological Polar Surface Area (TPSA) | 18.50 Ų |
| XlogP | 4.70 |
| There are no found synonyms. |
![2D Structure of (1R)-6-methoxy-1-[(4-methoxyphenyl)methyl]-1,2-dihydronaphthalene](https://plantaedb.com/storage/docs/compounds/2023/11/1r-6-methoxy-1-4-methoxyphenylmethyl-12-dihydronaphthalene.jpg "2D Structure of (1R)-6-methoxy-1-[(4-methoxyphenyl)methyl]-1,2-dihydronaphthalene")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.57% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 94.35% | 95.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.08% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.71% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.58% | 97.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.98% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.93% | 95.89% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.96% | 99.17% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.72% | 92.62% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.33% | 95.89% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.25% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.56% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.02% | 98.75% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 85.56% | 93.31% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.54% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.39% | 95.56% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.64% | 100.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.44% | 90.24% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.23% | 97.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.76% | 94.00% |
| CHEMBL240 | Q12809 | HERG | 80.69% | 89.76% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sequoia sempervirens |
| PubChem | 162951542 |
| LOTUS | LTS0198045 |
| wikiData | Q104957678 |