(1R)-10-hydroxy-3-methyl-1-propyl-1H-benzo[g]isochromene-6,9-dione
| Internal ID | f3fec95a-b21f-4ccc-a1a7-91c0c6155de2 |
| Taxonomy | Phenylpropanoids and polyketides > Isochromanequinones |
| IUPAC Name | (1R)-10-hydroxy-3-methyl-1-propyl-1H-benzo[g]isochromene-6,9-dione |
| SMILES (Canonical) | CCCC1C2=C(C3=C(C=C2C=C(O1)C)C(=O)C=CC3=O)O |
| SMILES (Isomeric) | CCC[C@@H]1C2=C(C3=C(C=C2C=C(O1)C)C(=O)C=CC3=O)O |
| InChI | InChI=1S/C17H16O4/c1-3-4-14-15-10(7-9(2)21-14)8-11-12(18)5-6-13(19)16(11)17(15)20/h5-8,14,20H,3-4H2,1-2H3/t14-/m1/s1 |
| InChI Key | XSRXAOMSAQPHJV-CQSZACIVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10485899 g/mol |
| Topological Polar Surface Area (TPSA) | 63.60 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.76% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.47% | 89.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.26% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.33% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.85% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.18% | 95.56% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.76% | 96.38% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.56% | 90.71% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.36% | 96.43% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.21% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.08% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.31% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162820828 |
| LOTUS | LTS0098400 |
| wikiData | Q105341199 |