Pyrrole-2,5-dicarboxylic acid
| Internal ID | 0d2f9fdb-b392-4005-8a68-906d46b1e5bc |
| Taxonomy | Organoheterocyclic compounds > Pyrroles > Pyrrole carboxylic acids and derivatives > Pyrrole carboxylic acids > Pyrrole 2-carboxylic acids |
| IUPAC Name | 1H-pyrrole-2,5-dicarboxylic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C6H5NO4/c8-5(9)3-1-2-4(7-3)6(10)11/h1-2,7H,(H,8,9)(H,10,11) |
| InChI Key | JLUIOEOHOOLSJC-UHFFFAOYSA-N |
| Popularity | 12 references in papers |
| Molecular Formula | C6H5NO4 |
| Molecular Weight | 155.11 g/mol |
| Exact Mass | 155.02185764 g/mol |
| Topological Polar Surface Area (TPSA) | 90.40 Ų |
| XlogP | 0.40 |
| 937-27-9 |
| Pyrrole-2,5-dicarboxylic acid |
| MFCD09991932 |
| pyrrole-2,5-dicarboxylic |
| 2,5-pyrroldicarboxylic acid |
| SCHEMBL70048 |
| YSWG648 |
| CHEBI:71161 |
| 1H-pyrrole-2,5-dicarboxylicAcid |
| AMY5008 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.91% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.61% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.93% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Berberis koreana |
| PubChem | 11846406 |
| LOTUS | LTS0027638 |
| wikiData | Q27139411 |