1H-Naphtho[2,3-c]pyran-5,10-dione
| Internal ID | d0cf7118-aa1f-4b2d-9bef-550a5d1a3655 |
| Taxonomy | Phenylpropanoids and polyketides > Isochromanequinones > Benzoisochromanequinones |
| IUPAC Name | 1H-benzo[g]isochromene-5,10-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H8O3/c14-12-8-3-1-2-4-9(8)13(15)11-7-16-6-5-10(11)12/h1-6H,7H2 |
| InChI Key | ODADCRFMCATOSN-UHFFFAOYSA-N |
| Popularity | 10 references in papers |
| Molecular Formula | C13H8O3 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.047344113 g/mol |
| Topological Polar Surface Area (TPSA) | 43.40 Ų |
| XlogP | 1.50 |
| 1H-Naphtho[2,3-c]pyran-5,10-dione |
| 106261-83-0 |
| SCHEMBL23762035 |
| DTXSID20437516 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.57% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.57% | 98.95% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.89% | 82.69% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 86.16% | 96.67% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.09% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.88% | 91.49% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.49% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dolichopentas longiflora |
| Mitracarpus hirtus |
| PubChem | 10262591 |
| LOTUS | LTS0027977 |
| wikiData | Q82253028 |