1h-Isoindol-1-one,2,3-dihydro-4-hydroxy-5,6-dimethoxy-
| Internal ID | d70983dc-78f2-40b9-a487-02dba6a4551f |
| Taxonomy | Organoheterocyclic compounds > Isoindoles and derivatives > Isoindolines > Isoindolones |
| IUPAC Name | 4-hydroxy-5,6-dimethoxy-2,3-dihydroisoindol-1-one |
| SMILES (Canonical) | COC1=C(C(=C2CNC(=O)C2=C1)O)OC |
| SMILES (Isomeric) | COC1=C(C(=C2CNC(=O)C2=C1)O)OC |
| InChI | InChI=1S/C10H11NO4/c1-14-7-3-5-6(4-11-10(5)13)8(12)9(7)15-2/h3,12H,4H2,1-2H3,(H,11,13) |
| InChI Key | WPPQGGXKHNJQJP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.06880783 g/mol |
| Topological Polar Surface Area (TPSA) | 67.80 Ų |
| XlogP | 0.40 |
| 1h-isoindol-1-one,2,3-dihydro-4-hydroxy-5,6-dimethoxy- |
| 1321601-68-6 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.13% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.10% | 96.09% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.33% | 95.64% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.62% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.52% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.45% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.15% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.60% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.13% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.03% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.72% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.08% | 85.14% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.79% | 95.56% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.78% | 91.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aegiceras corniculatum |
| PubChem | 53363661 |
| LOTUS | LTS0245446 |
| wikiData | Q77511992 |