6-Prenyltryptophol
| Internal ID | 266bae27-90f0-42b6-91cd-205bb9f889b7 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles > 3-alkylindoles |
| IUPAC Name | 2-[6-(3-methylbut-2-enyl)-1H-indol-3-yl]ethanol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H19NO/c1-11(2)3-4-12-5-6-14-13(7-8-17)10-16-15(14)9-12/h3,5-6,9-10,16-17H,4,7-8H2,1-2H3 |
| InChI Key | OMYAYZKRMLYPNC-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.146664230 g/mol |
| Topological Polar Surface Area (TPSA) | 36.00 Ų |
| XlogP | 3.70 |
| 583060-24-6 |
| 1H-Indole-3-ethanol, 6-(3-methyl-2-butenyl)- |
| 2-[6-(3-methylbut-2-enyl)-1H-indol-3-yl]ethanol |
| SCHEMBL16433255 |
| DTXSID90438237 |
| BS-1616 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.43% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.81% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.22% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.09% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.92% | 96.09% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 85.16% | 90.24% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.06% | 94.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.68% | 94.73% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.24% | 92.62% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 82.04% | 91.38% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 82.00% | 97.88% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.73% | 86.92% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.75% | 91.71% |
| CHEMBL5485 | P14920 | D-amino-acid oxidase | 80.60% | 96.57% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.45% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.12% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10331409 |
| LOTUS | LTS0196548 |
| wikiData | Q77310634 |