1H-indole-3-carboxamide
| Internal ID | 3f6856f3-d076-4c21-ad7f-42125de270c8 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolecarboxylic acids and derivatives > Indolecarboxamides and derivatives |
| IUPAC Name | 1H-indole-3-carboxamide |
| SMILES (Canonical) | C1=CC=C2C(=C1)C(=CN2)C(=O)N |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C(=CN2)C(=O)N |
| InChI | InChI=1S/C9H8N2O/c10-9(12)7-5-11-8-4-2-1-3-6(7)8/h1-5,11H,(H2,10,12) |
| InChI Key | LSGKMZLPZFPAIN-UHFFFAOYSA-N |
| Popularity | 60 references in papers |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.063662883 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 1.30 |
| 1H-Indole-3-carboxylic acid amide |
| 1670-85-5 |
| indole-3-carboxamide |
| 1H-Indole-3-carboxamide(9CI) |
| 1-H-Indole-3-carboxamide |
| Cambridge id 5106715 |
| MLS001048867 |
| SCHEMBL117198 |
| CHEMBL379099 |
| BDBM93016 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
39810.7 nM |
Potency |
via CMAUP
|
| CHEMBL3797 | Q13315 | Serine-protein kinase ATM |
631 nM 631 nM |
Potency Potency |
PMID: 20550123
via Super-PRED |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.30% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.52% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.31% | 96.09% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 89.70% | 83.10% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.66% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.60% | 94.45% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 83.80% | 95.56% |
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 82.46% | 81.14% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 81.27% | 88.56% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 80.70% | 93.81% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Isatis tinctoria |
| PubChem | 2192542 |
| NPASS | NPC131718 |
| ChEMBL | CHEMBL379099 |
| LOTUS | LTS0010601 |
| wikiData | Q82152400 |