(3S,3aS,5aR,6R,9aS,9bS)-3,5a,9-trimethyl-2-methylidene-3,3a,4,5,6,7,9a,9b-octahydrobenzo[g][1]benzofuran-6-ol
| Internal ID | 8c74983d-854f-4fa1-9757-9e15e4ce8c40 |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | (3S,3aS,5aR,6R,9aS,9bS)-3,5a,9-trimethyl-2-methylidene-3,3a,4,5,6,7,9a,9b-octahydrobenzo[g][1]benzofuran-6-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H24O2/c1-9-5-6-13(17)16(4)8-7-12-10(2)11(3)18-15(12)14(9)16/h5,10,12-15,17H,3,6-8H2,1-2,4H3/t10-,12+,13-,14-,15+,16+/m1/s1 |
| InChI Key | STIYXYABWPDGCS-PRLTYNAASA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.177630004 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
![2D Structure of (3S,3aS,5aR,6R,9aS,9bS)-3,5a,9-trimethyl-2-methylidene-3,3a,4,5,6,7,9a,9b-octahydrobenzo[g][1]benzofuran-6-ol](https://plantaedb.com/storage/docs/compounds/2023/11/1fe74990-8634-11ee-8ae8-a7d8326a2026.jpg "2D Structure of (3S,3aS,5aR,6R,9aS,9bS)-3,5a,9-trimethyl-2-methylidene-3,3a,4,5,6,7,9a,9b-octahydrobenzo[g][1]benzofuran-6-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1871 | P10275 | Androgen Receptor | 90.54% | 96.43% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 88.59% | 86.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.50% | 100.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.44% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.46% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.82% | 97.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.32% | 96.38% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.24% | 96.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.66% | 92.94% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.61% | 94.45% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 81.85% | 89.05% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.72% | 90.24% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.32% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.19% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163075279 |
| LOTUS | LTS0235318 |
| wikiData | Q105260279 |