[19-(Furan-3-yl)-9,9,13,20-tetramethyl-5,11,17-trioxo-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosan-12-yl] acetate
Internal ID | 81b6a1f4-04b2-451f-85a9-6ae6f6dd8973 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones |
IUPAC Name | [19-(furan-3-yl)-9,9,13,20-tetramethyl-5,11,17-trioxo-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosan-12-yl] acetate |
SMILES (Canonical) | CC(=O)OC1C(=O)C2C(OC3C2(COC(=O)C3)C4C1(C56C(O5)C(=O)OC(C6(CC4)C)C7=COC=C7)C)(C)C |
SMILES (Isomeric) | CC(=O)OC1C(=O)C2C(OC3C2(COC(=O)C3)C4C1(C56C(O5)C(=O)OC(C6(CC4)C)C7=COC=C7)C)(C)C |
InChI | InChI=1S/C28H32O10/c1-13(29)35-21-18(31)19-24(2,3)37-16-10-17(30)34-12-27(16,19)15-6-8-25(4)20(14-7-9-33-11-14)36-23(32)22-28(25,38-22)26(15,21)5/h7,9,11,15-16,19-22H,6,8,10,12H2,1-5H3 |
InChI Key | YBJGIQUVRQCMSY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O10 |
Molecular Weight | 528.50 g/mol |
Exact Mass | 528.19954721 g/mol |
Topological Polar Surface Area (TPSA) | 131.00 Ų |
XlogP | 1.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.70% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.96% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.84% | 94.45% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.30% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 91.63% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.17% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.63% | 89.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.65% | 82.69% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.76% | 93.04% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.37% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.63% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.59% | 86.33% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.32% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.08% | 95.89% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.62% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.44% | 95.56% |
CHEMBL3837 | P07711 | Cathepsin L | 81.90% | 96.61% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.90% | 91.19% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.64% | 95.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.10% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.30% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Microula sikkimensis |
PubChem | 13818964 |
LOTUS | LTS0108167 |
wikiData | Q105345872 |