2-[10,13-dimethyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,5,6,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-hydroxy-5-propan-2-yl-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptanoic acid
Internal ID | 9864c5cd-407a-4174-b043-0a14a46b4660 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | 2-[10,13-dimethyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,5,6,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-hydroxy-5-propan-2-yl-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptanoic acid |
SMILES (Canonical) | CC(C)C(CCC(C1CCC2C1(CC=C3C2=CCC4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C)C(=O)O)(C(C)OC6C(C(C(C(O6)CO)O)O)O)O |
SMILES (Isomeric) | CC(C)C(CCC(C1CCC2C1(CC=C3C2=CCC4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C)C(=O)O)(C(C)OC6C(C(C(C(O6)CO)O)O)O)O |
InChI | InChI=1S/C41H66O15/c1-19(2)41(52,20(3)53-37-34(48)32(46)30(44)28(17-42)55-37)15-11-24(36(50)51)26-9-8-25-23-7-6-21-16-22(10-13-39(21,4)27(23)12-14-40(25,26)5)54-38-35(49)33(47)31(45)29(18-43)56-38/h7,12,19-22,24-26,28-35,37-38,42-49,52H,6,8-11,13-18H2,1-5H3,(H,50,51) |
InChI Key | AVZXSMXBYXMDGT-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H66O15 |
Molecular Weight | 799.00 g/mol |
Exact Mass | 798.44017139 g/mol |
Topological Polar Surface Area (TPSA) | 256.00 Ų |
XlogP | 1.30 |
There are no found synonyms. |
![2D Structure of 2-[10,13-dimethyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,5,6,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-hydroxy-5-propan-2-yl-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptanoic acid 2D Structure of 2-[10,13-dimethyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,5,6,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-hydroxy-5-propan-2-yl-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptanoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/1fb99930-8618-11ee-9654-c5e19fd02b39.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.86% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.29% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.74% | 97.25% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 97.08% | 94.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.89% | 97.09% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.64% | 94.62% |
CHEMBL2581 | P07339 | Cathepsin D | 90.91% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.87% | 94.45% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 89.91% | 94.08% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 88.48% | 94.97% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.06% | 92.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.05% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.90% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.94% | 93.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.85% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.33% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.18% | 86.33% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.33% | 96.47% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.19% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 83.00% | 97.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.48% | 100.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.41% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.16% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.29% | 99.17% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.06% | 97.14% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.01% | 96.37% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.98% | 98.05% |
CHEMBL237 | P41145 | Kappa opioid receptor | 80.97% | 98.10% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.69% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Decaneuropsis cumingiana |
PubChem | 74429229 |
LOTUS | LTS0222589 |
wikiData | Q104919925 |