(5S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one
Internal ID | 2789dff8-1c0f-429f-811e-982ee2d58a91 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Ergostane steroids > Ergosterols and derivatives |
IUPAC Name | (5S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
SMILES (Canonical) | CC(C)C(C)CCC(C)C1CCC2C1(CCC3C2CCC4C3(CCC(=O)C4)C)C |
SMILES (Isomeric) | C[C@H](CC[C@@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@@H]2CC[C@@H]4[C@]3(CCC(=O)C4)C)C |
InChI | InChI=1S/C28H48O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h18-21,23-26H,7-17H2,1-6H3/t19-,20-,21+,23-,24-,25+,26+,27-,28-/m1/s1 |
InChI Key | DDJMOMHMVFXEQF-VGXPIAPGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H48O |
Molecular Weight | 400.70 g/mol |
Exact Mass | 400.370516150 g/mol |
Topological Polar Surface Area (TPSA) | 17.10 Ų |
XlogP | 9.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.06% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.32% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.73% | 98.95% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.56% | 90.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.55% | 100.00% |
CHEMBL233 | P35372 | Mu opioid receptor | 89.52% | 97.93% |
CHEMBL1871 | P10275 | Androgen Receptor | 89.49% | 96.43% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.06% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.95% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.77% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.33% | 95.89% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.97% | 85.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.81% | 90.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.47% | 94.45% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.63% | 93.04% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.63% | 97.05% |
CHEMBL237 | P41145 | Kappa opioid receptor | 81.34% | 98.10% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.33% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arabidopsis thaliana |
PubChem | 162951597 |
LOTUS | LTS0254096 |
wikiData | Q104976430 |