(1S,4E,7R,8S,12R,18S)-8-hydroxy-5,7,8-trimethyl-2,10-dioxa-15-azatricyclo[10.5.1.015,18]octadec-4-ene-3,9-dione
Internal ID | 583b2f6c-1046-4da7-aeb1-d3ac9dd1e91f |
Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
IUPAC Name | (1S,4E,7R,8S,12R,18S)-8-hydroxy-5,7,8-trimethyl-2,10-dioxa-15-azatricyclo[10.5.1.015,18]octadec-4-ene-3,9-dione |
SMILES (Canonical) | CC1CC(=CC(=O)OC2CCN3C2C(CC3)COC(=O)C1(C)O)C |
SMILES (Isomeric) | C[C@@H]1C/C(=C/C(=O)O[C@H]2CCN3[C@H]2[C@@H](CC3)COC(=O)[C@@]1(C)O)/C |
InChI | InChI=1S/C18H27NO5/c1-11-8-12(2)18(3,22)17(21)23-10-13-4-6-19-7-5-14(16(13)19)24-15(20)9-11/h9,12-14,16,22H,4-8,10H2,1-3H3/b11-9+/t12-,13+,14+,16+,18+/m1/s1 |
InChI Key | KUYRTCOXLIWTED-BIHLUJSHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H27NO5 |
Molecular Weight | 337.40 g/mol |
Exact Mass | 337.18892296 g/mol |
Topological Polar Surface Area (TPSA) | 76.10 Ų |
XlogP | 1.50 |
62018-77-3 |
![2D Structure of (1S,4E,7R,8S,12R,18S)-8-hydroxy-5,7,8-trimethyl-2,10-dioxa-15-azatricyclo[10.5.1.015,18]octadec-4-ene-3,9-dione 2D Structure of (1S,4E,7R,8S,12R,18S)-8-hydroxy-5,7,8-trimethyl-2,10-dioxa-15-azatricyclo[10.5.1.015,18]octadec-4-ene-3,9-dione](https://plantaedb.com/storage/docs/compounds/2023/11/1f81cbb0-858a-11ee-9858-cdad3bc661c6.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.41% | 97.25% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 92.57% | 86.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.34% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.23% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.43% | 95.89% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.86% | 93.40% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.76% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.17% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.36% | 85.14% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 84.52% | 94.78% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.16% | 89.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.05% | 96.43% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.45% | 86.33% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.41% | 82.38% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.29% | 93.03% |
CHEMBL279 | P35968 | Vascular endothelial growth factor receptor 2 | 82.20% | 95.52% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.98% | 97.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.62% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.00% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senecio cacaliaster |
Senecio callosus |
Senecio nemorensis |
PubChem | 133645847 |
LOTUS | LTS0188012 |
wikiData | Q104396969 |