methyl (4S,5E,6S)-5-ethylidene-6-[(2S,3R,4S,5S,6R)-6-[[2-[(2S,3Z,4S)-3-[2-[2-[(2S,3Z,4S)-3-ethylidene-5-methoxycarbonyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetyl]oxyethylidene]-5-methoxycarbonyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-4-(2-methoxy-2-oxoethyl)-4H-pyran-3-carboxylate
Internal ID | ad55a7b5-8a9c-428c-a2d2-86260602d8e0 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Hexacarboxylic acids and derivatives |
IUPAC Name | methyl (4S,5E,6S)-5-ethylidene-6-[(2S,3R,4S,5S,6R)-6-[[2-[(2S,3Z,4S)-3-[2-[2-[(2S,3Z,4S)-3-ethylidene-5-methoxycarbonyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetyl]oxyethylidene]-5-methoxycarbonyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-4-(2-methoxy-2-oxoethyl)-4H-pyran-3-carboxylate |
SMILES (Canonical) | CC=C1C(C(=COC1OC2C(C(C(C(O2)COC(=O)CC3C(=COC(C3=CCOC(=O)CC4C(=COC(C4=CC)OC5C(C(C(C(O5)CO)O)O)O)C(=O)OC)OC6C(C(C(C(O6)CO)O)O)O)C(=O)OC)O)O)O)C(=O)OC)CC(=O)OC |
SMILES (Isomeric) | C/C=C/1\[C@@H](C(=CO[C@H]1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)COC(=O)C[C@@H]\3C(=CO[C@H](/C3=C\COC(=O)C[C@@H]\4C(=CO[C@H](/C4=C\C)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C(=O)OC)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C(=O)OC)O)O)O)C(=O)OC)CC(=O)OC |
InChI | InChI=1S/C52H70O32/c1-7-20-23(11-32(55)70-3)26(44(67)71-4)16-76-47(20)83-52-43(66)40(63)37(60)31(81-52)19-75-34(57)13-25-22(49(78-18-28(25)46(69)73-6)84-51-42(65)39(62)36(59)30(15-54)80-51)9-10-74-33(56)12-24-21(8-2)48(77-17-27(24)45(68)72-5)82-50-41(64)38(61)35(58)29(14-53)79-50/h7-9,16-18,23-25,29-31,35-43,47-54,58-66H,10-15,19H2,1-6H3/b20-7+,21-8-,22-9-/t23-,24-,25-,29+,30+,31+,35+,36+,37+,38-,39-,40-,41+,42+,43+,47-,48-,49-,50-,51-,52-/m0/s1 |
InChI Key | WUFIEEVFNXQTNM-HLQTZQBDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C52H70O32 |
Molecular Weight | 1207.10 g/mol |
Exact Mass | 1206.3850200 g/mol |
Topological Polar Surface Area (TPSA) | 463.00 Ų |
XlogP | -6.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.23% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.29% | 91.11% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.91% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.77% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.79% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.07% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.58% | 99.17% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.64% | 95.83% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.29% | 94.33% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.15% | 92.50% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.29% | 96.90% |
CHEMBL5028 | O14672 | ADAM10 | 80.71% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Jasminum polyanthum |
PubChem | 102316570 |
LOTUS | LTS0148151 |
wikiData | Q105313014 |