[(2S,3S,4S,5S,6S)-4,5-dihydroxy-6-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-2-(6-oxo-3H-purin-9-yl)oxolan-3-yl]oxy-2-methyloxan-3-yl] (2E,4E,7E,9S)-9-[(2E,4E)-octa-2,4-dienoyl]oxydeca-2,4,7-trienoate
| Internal ID | 2a4f04f1-5fe4-46ff-b1bd-3fea010ee5cd |
| Taxonomy | Nucleosides, nucleotides, and analogues > Purine nucleosides |
| IUPAC Name | [(2S,3S,4S,5S,6S)-4,5-dihydroxy-6-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-2-(6-oxo-3H-purin-9-yl)oxolan-3-yl]oxy-2-methyloxan-3-yl] (2E,4E,7E,9S)-9-[(2E,4E)-octa-2,4-dienoyl]oxydeca-2,4,7-trienoate |
| SMILES (Canonical) | CCCC=CC=CC(=O)OC(C)C=CCC=CC=CC(=O)OC1C(OC(C(C1O)O)OC2C(C(OC2N3C=NC4=C3NC=NC4=O)CO)O)C |
| SMILES (Isomeric) | CCC/C=C/C=C/C(=O)O[C@@H](C)/C=C/C/C=C/C=C/C(=O)O[C@@H]1[C@@H](O[C@H]([C@H]([C@@H]1O)O)O[C@@H]2[C@@H]([C@H](O[C@H]2N3C=NC4=C3NC=NC4=O)CO)O)C |
| InChI | InChI=1S/C34H44N4O12/c1-4-5-6-8-12-15-23(40)46-20(2)14-11-9-7-10-13-16-24(41)49-29-21(3)47-34(28(44)27(29)43)50-30-26(42)22(17-39)48-33(30)38-19-37-25-31(38)35-18-36-32(25)45/h6-8,10-16,18-22,26-30,33-34,39,42-44H,4-5,9,17H2,1-3H3,(H,35,36,45)/b8-6+,10-7+,14-11+,15-12+,16-13+/t20-,21-,22+,26+,27-,28-,29+,30+,33+,34-/m0/s1 |
| InChI Key | KZAQVIOGOYWYER-BPGWBWJDSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C34H44N4O12 |
| Molecular Weight | 700.70 g/mol |
| Exact Mass | 700.29557285 g/mol |
| Topological Polar Surface Area (TPSA) | 221.00 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.15% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.03% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.91% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.43% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.87% | 91.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.30% | 99.23% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.81% | 97.36% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.70% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.62% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.05% | 96.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 87.19% | 95.93% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.04% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.06% | 94.45% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.42% | 89.34% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.20% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101659109 |
| LOTUS | LTS0224106 |
| wikiData | Q104402866 |