(8-hydroxy-9-methyl-3,6-dimethylidene-2-oxo-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-4-yl) 2-methylprop-2-enoate
| Internal ID | 0898cc44-e1cb-4f60-b8d0-8d14430f3a85 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Guaianolides and derivatives |
| IUPAC Name | (8-hydroxy-9-methyl-3,6-dimethylidene-2-oxo-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-4-yl) 2-methylprop-2-enoate |
| SMILES (Canonical) | CC1C(CC2C1C3C(C(CC2=C)OC(=O)C(=C)C)C(=C)C(=O)O3)O |
| SMILES (Isomeric) | CC1C(CC2C1C3C(C(CC2=C)OC(=O)C(=C)C)C(=C)C(=O)O3)O |
| InChI | InChI=1S/C19H24O5/c1-8(2)18(21)23-14-6-9(3)12-7-13(20)10(4)15(12)17-16(14)11(5)19(22)24-17/h10,12-17,20H,1,3,5-7H2,2,4H3 |
| InChI Key | FQKDBWKMFCRELP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16237386 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of (8-hydroxy-9-methyl-3,6-dimethylidene-2-oxo-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-4-yl) 2-methylprop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/1f385bd0-8363-11ee-86e3-2375eaab4eb6.jpg "2D Structure of (8-hydroxy-9-methyl-3,6-dimethylidene-2-oxo-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-4-yl) 2-methylprop-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.42% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.41% | 91.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.93% | 99.23% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.64% | 95.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.60% | 97.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.00% | 97.79% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 85.53% | 83.82% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.47% | 89.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.17% | 91.19% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.79% | 97.25% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.06% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.25% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.00% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.77% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.73% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.21% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Centaurea behen |
| PubChem | 163032775 |
| LOTUS | LTS0129139 |
| wikiData | Q104999690 |