[2,2'-Bibenzocyclodecene]-1,1'-diol, 5,5',8,8',9,9',12,12'-octahydro-4,4'-dimethoxy-7,7',11,11'-tetramethyl-, (6E,6'E,10Z,10'Z)-
| Internal ID | 44301b7a-a756-461c-8bbf-a70461292f14 |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | (6E,10Z)-2-[(6E,10Z)-1-hydroxy-4-methoxy-7,11-dimethyl-5,8,9,12-tetrahydrobenzo[10]annulen-2-yl]-4-methoxy-7,11-dimethyl-5,8,9,12-tetrahydrobenzo[10]annulen-1-ol |
| SMILES (Canonical) | CC1=CCC2=C(C=C(C(=C2CC(=CCC1)C)O)C3=CC(=C4CC=C(CCC=C(CC4=C3O)C)C)OC)OC |
| SMILES (Isomeric) | C/C/1=C\CC2=C(C=C(C(=C2C/C(=C\CC1)/C)O)C3=CC(=C4C(=C3O)C/C(=C\CC/C(=C/C4)/C)/C)OC)OC |
| InChI | InChI=1S/C34H42O4/c1-21-9-7-11-23(3)17-27-25(15-13-21)31(37-5)19-29(33(27)35)30-20-32(38-6)26-16-14-22(2)10-8-12-24(4)18-28(26)34(30)36/h11-14,19-20,35-36H,7-10,15-18H2,1-6H3/b21-13+,22-14+,23-11-,24-12- |
| InChI Key | FFUHECWLQYKEQO-VWJDWPEPSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C34H42O4 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.30830982 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 7.40 |
| [2,2'-Bibenzocyclodecene]-1,1'-diol, 5,5',8,8',9,9',12,12'-octahydro-4,4'-dimethoxy-7,7',11,11'-tetramethyl-, (6E,6'E,10Z,10'Z)- |
| 117568-34-0 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.94% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.76% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.62% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.53% | 92.94% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.63% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.27% | 86.33% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 85.80% | 95.70% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.86% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.57% | 98.75% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 83.86% | 91.00% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 81.64% | 98.21% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.58% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.21% | 89.00% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.58% | 97.36% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.35% | 95.50% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.27% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 165366825 |
| LOTUS | LTS0121837 |
| wikiData | Q104994679 |