(2S,3R,4R,5R,6S)-2-[(2S,3S,4S,5S,6R)-2-[(1R,2S,3'S,4S,5'S,6S,7S,8S,9S,12S,13R,16S)-3',8-dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 8f48b7b5-587f-4c45-86af-ddff270e2939 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2S,3S,4S,5S,6R)-2-[(1R,2S,3'S,4S,5'S,6S,7S,8S,9S,12S,13R,16S)-3',8-dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CC(C2(C(C3(C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)C7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)O)C)OC1)O |
SMILES (Isomeric) | C[C@H]1C[C@@H]([C@@]2([C@H]([C@]3([C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)[C@H]7[C@@H]([C@H]([C@H]([C@H](O7)CO)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)C)C)O)C)OC1)O |
InChI | InChI=1S/C44H70O17/c1-18-12-28(47)44(56-16-18)20(3)43(54)29(61-44)14-25-23-7-6-22-13-21(8-10-41(22,4)24(23)9-11-42(25,43)5)36-38(60-40-35(53)33(51)30(48)19(2)57-40)37(32(50)27(15-45)58-36)59-39-34(52)31(49)26(46)17-55-39/h6,18-21,23-40,45-54H,7-17H2,1-5H3/t18-,19-,20-,21-,23+,24-,25-,26+,27+,28-,29-,30-,31-,32-,33+,34+,35+,36-,37-,38-,39-,40-,41-,42-,43+,44-/m0/s1 |
InChI Key | WOZRNTKZPORAKW-ZOIRUQMTSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C44H70O17 |
Molecular Weight | 871.00 g/mol |
Exact Mass | 870.46130076 g/mol |
Topological Polar Surface Area (TPSA) | 267.00 Ų |
XlogP | -0.30 |
There are no found synonyms. |
![2D Structure of (2S,3R,4R,5R,6S)-2-[(2S,3S,4S,5S,6R)-2-[(1R,2S,3'S,4S,5'S,6S,7S,8S,9S,12S,13R,16S)-3',8-dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol 2D Structure of (2S,3R,4R,5R,6S)-2-[(2S,3S,4S,5S,6R)-2-[(1R,2S,3'S,4S,5'S,6S,7S,8S,9S,12S,13R,16S)-3',8-dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/1efa1cb0-86f6-11ee-a33f-9181c1e12415.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.36% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.93% | 91.11% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 95.37% | 95.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.31% | 95.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.10% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.79% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.45% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.69% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.18% | 89.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.09% | 96.61% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.07% | 94.75% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.81% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.79% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 84.89% | 98.95% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.23% | 91.24% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.21% | 95.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.10% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.84% | 95.89% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 82.71% | 97.53% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.65% | 95.56% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.39% | 89.67% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.82% | 94.23% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.68% | 92.88% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.82% | 94.08% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.79% | 96.43% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.24% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum myriacanthum |
PubChem | 100933836 |
LOTUS | LTS0073445 |
wikiData | Q105309762 |