6-hexanoyl-4a,7-dihydroxy-2,2,4,4,10,10,12,12-octamethyl-8,14-di(propan-2-yl)-14,14a-dihydro-8H-chromeno[2,3-a]xanthene-1,3,9,11-tetrone
Internal ID | d5d3d256-7809-4b49-bfd1-6346af28744e |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthenes |
IUPAC Name | 6-hexanoyl-4a,7-dihydroxy-2,2,4,4,10,10,12,12-octamethyl-8,14-di(propan-2-yl)-14,14a-dihydro-8H-chromeno[2,3-a]xanthene-1,3,9,11-tetrone |
SMILES (Canonical) | CCCCCC(=O)C1=C2C(=C3C(=C1O)C(C4=C(O3)C(C(=O)C(C4=O)(C)C)(C)C)C(C)C)C(C5C(=O)C(C(=O)C(C5(O2)O)(C)C)(C)C)C(C)C |
SMILES (Isomeric) | CCCCCC(=O)C1=C2C(=C3C(=C1O)C(C4=C(O3)C(C(=O)C(C4=O)(C)C)(C)C)C(C)C)C(C5C(=O)C(C(=O)C(C5(O2)O)(C)C)(C)C)C(C)C |
InChI | InChI=1S/C40H54O9/c1-14-15-16-17-20(41)23-28(42)24-21(18(2)3)26-31(43)36(6,7)34(45)38(10,11)33(26)48-29(24)25-22(19(4)5)27-32(44)37(8,9)35(46)39(12,13)40(27,47)49-30(23)25/h18-19,21-22,27,42,47H,14-17H2,1-13H3 |
InChI Key | VCHNRICAPWWRIS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H54O9 |
Molecular Weight | 678.80 g/mol |
Exact Mass | 678.37678330 g/mol |
Topological Polar Surface Area (TPSA) | 144.00 Ų |
XlogP | 7.90 |
There are no found synonyms. |
![2D Structure of 6-hexanoyl-4a,7-dihydroxy-2,2,4,4,10,10,12,12-octamethyl-8,14-di(propan-2-yl)-14,14a-dihydro-8H-chromeno[2,3-a]xanthene-1,3,9,11-tetrone 2D Structure of 6-hexanoyl-4a,7-dihydroxy-2,2,4,4,10,10,12,12-octamethyl-8,14-di(propan-2-yl)-14,14a-dihydro-8H-chromeno[2,3-a]xanthene-1,3,9,11-tetrone](https://plantaedb.com/storage/docs/compounds/2023/11/1ec66f70-858a-11ee-80ef-0feff05cab96.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.11% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 98.95% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.77% | 97.25% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.66% | 83.82% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.24% | 89.63% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 97.53% | 95.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.52% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.84% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.54% | 90.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.66% | 99.23% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 93.33% | 95.92% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 90.77% | 97.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.52% | 97.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.92% | 93.99% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.71% | 91.24% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.69% | 93.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.97% | 99.17% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.78% | 90.08% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.24% | 94.75% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.46% | 92.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.51% | 100.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.36% | 96.38% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.96% | 89.00% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 81.51% | 92.78% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.36% | 100.00% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.22% | 98.33% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.87% | 94.33% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.78% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Corymbia scabrida |
PubChem | 74423090 |
LOTUS | LTS0220469 |
wikiData | Q105283695 |