[2-Hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] 3-(4-methoxyphenyl)prop-2-enoate
Internal ID | 44723e67-f460-4fe0-ab3e-0dec7e606ec0 |
Taxonomy | Lipids and lipid-like molecules > Glycerolipids > Glycosylglycerols > Glycosylmonoacylglycerols |
IUPAC Name | [2-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] 3-(4-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=CC=C(C=C1)C=CC(=O)OCC(COC2C(C(C(C(O2)CO)O)O)O)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)C=CC(=O)OCC(COC2C(C(C(C(O2)CO)O)O)O)O |
InChI | InChI=1S/C19H26O10/c1-26-13-5-2-11(3-6-13)4-7-15(22)27-9-12(21)10-28-19-18(25)17(24)16(23)14(8-20)29-19/h2-7,12,14,16-21,23-25H,8-10H2,1H3 |
InChI Key | LENQPFHDGQUMMQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H26O10 |
Molecular Weight | 414.40 g/mol |
Exact Mass | 414.15259702 g/mol |
Topological Polar Surface Area (TPSA) | 155.00 Ų |
XlogP | -0.70 |
There are no found synonyms. |
![2D Structure of [2-Hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] 3-(4-methoxyphenyl)prop-2-enoate 2D Structure of [2-Hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] 3-(4-methoxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/1ec51650-860a-11ee-974f-05a505787c9e.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.43% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.68% | 96.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.39% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.85% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.81% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.49% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.77% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.57% | 85.14% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.17% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.40% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.60% | 90.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.89% | 90.17% |
CHEMBL2581 | P07339 | Cathepsin D | 81.72% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.16% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.00% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lilium henryi |
PubChem | 163038753 |
LOTUS | LTS0074835 |
wikiData | Q105150667 |