10-[5-[4,5-Dihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-hydroxy-4,5,9,9,13,20-hexamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosane-20-carbaldehyde
Internal ID | cc80a81b-4c6d-47a6-88f5-6730f9c14bdc |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 10-[5-[4,5-dihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-hydroxy-4,5,9,9,13,20-hexamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosane-20-carbaldehyde |
SMILES (Canonical) | CC1(C2CCC3(C(C2(CCC1OC4C(C(C(CO4)OC5C(C(C(C(O5)COC6C(C(C(C(O6)CO)O)O)O)O)O)OC7C(C(C(CO7)O)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)CCC91C3(CC(C2(C9CC(CC2)(C)C=O)CO1)O)C)C)C |
SMILES (Isomeric) | CC1(C2CCC3(C(C2(CCC1OC4C(C(C(CO4)OC5C(C(C(C(O5)COC6C(C(C(C(O6)CO)O)O)O)O)O)OC7C(C(C(CO7)O)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)CCC91C3(CC(C2(C9CC(CC2)(C)C=O)CO1)O)C)C)C |
InChI | InChI=1S/C58H94O27/c1-52(2)29-7-11-55(5)30(8-12-58-31-15-53(3,22-61)13-14-57(31,23-78-58)32(63)16-56(55,58)6)54(29,4)10-9-33(52)83-50-45(85-49-44(74)40(70)36(66)26(18-60)80-49)38(68)28(21-77-50)82-51-46(84-48-42(72)34(64)24(62)19-75-48)41(71)37(67)27(81-51)20-76-47-43(73)39(69)35(65)25(17-59)79-47/h22,24-51,59-60,62-74H,7-21,23H2,1-6H3 |
InChI Key | OPQUPAIXWBVUBV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C58H94O27 |
Molecular Weight | 1223.30 g/mol |
Exact Mass | 1222.59824772 g/mol |
Topological Polar Surface Area (TPSA) | 422.00 Ų |
XlogP | -3.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.38% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.26% | 95.93% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.00% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 90.09% | 98.95% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 90.08% | 91.24% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.01% | 95.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.37% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.64% | 97.09% |
CHEMBL1871 | P10275 | Androgen Receptor | 88.55% | 96.43% |
CHEMBL233 | P35372 | Mu opioid receptor | 88.45% | 97.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.97% | 100.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.94% | 96.61% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.69% | 95.89% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.25% | 94.33% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 86.18% | 97.28% |
CHEMBL5957 | P21589 | 5'-nucleotidase | 86.07% | 97.78% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.50% | 94.75% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.73% | 92.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.32% | 95.89% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.91% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.90% | 90.17% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.73% | 96.21% |
CHEMBL5028 | O14672 | ADAM10 | 81.89% | 97.50% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.59% | 82.38% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.26% | 96.77% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 81.19% | 92.98% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 81.18% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.51% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cyclamen mirabile |
Cyclamen persicum |
PubChem | 14217279 |
LOTUS | LTS0087019 |
wikiData | Q105196518 |