(1E,4E)-1,5-bis(4-hydroxy-3-methoxyphenyl)penta-1,4-dien-3-one
| Internal ID | 7d618b53-2c76-4765-8a89-99f76507d7f7 |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives |
| IUPAC Name | (1E,4E)-1,5-bis(4-hydroxy-3-methoxyphenyl)penta-1,4-dien-3-one |
| SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC(=O)C=CC2=CC(=C(C=C2)O)OC)O |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)/C=C/C(=O)/C=C/C2=CC(=C(C=C2)O)OC)O |
| InChI | InChI=1S/C19H18O5/c1-23-18-11-13(5-9-16(18)21)3-7-15(20)8-4-14-6-10-17(22)19(12-14)24-2/h3-12,21-22H,1-2H3/b7-3+,8-4+ |
| InChI Key | ISIMGBQRFXXNON-FCXRPNKRSA-N |
| Popularity | 19 references in papers |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.11542367 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 3.30 |
| Atomic LogP (AlogP) | 3.41 |
| H-Bond Acceptor | 5 |
| H-Bond Donor | 2 |
| Rotatable Bonds | 6 |
| 1,5-Bis(4-hydroxy-3-methoxyphenyl)-1,4-pentadien-3-one |
| RefChem:1053418 |
| Go-Y022 |
| CHEMBL128729 |
| 131359-25-6 |
| 1,5-Bis(4-hydroxy-3-methoxyphenyl)penta-1,4-dien-3-one |
| FLLL11 |
| SCHEMBL1493282 |
| SCHEMBL29478095 |
| DTXSID001176618 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9908 | 99.08% |
| Caco-2 | + | 0.5000 | 50.00% |
| Blood Brain Barrier | - | 0.7000 | 70.00% |
| Human oral bioavailability | + | 0.5714 | 57.14% |
| Subcellular localzation | Mitochondria | 0.8429 | 84.29% |
| OATP2B1 inhibitior | - | 0.7078 | 70.78% |
| OATP1B1 inhibitior | + | 0.9563 | 95.63% |
| OATP1B3 inhibitior | + | 0.9614 | 96.14% |
| MATE1 inhibitior | - | 0.9200 | 92.00% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | + | 0.7472 | 74.72% |
| P-glycoprotein inhibitior | + | 0.5714 | 57.14% |
| P-glycoprotein substrate | - | 0.9763 | 97.63% |
| CYP3A4 substrate | - | 0.6366 | 63.66% |
| CYP2C9 substrate | - | 0.6000 | 60.00% |
| CYP2D6 substrate | - | 0.7829 | 78.29% |
| CYP3A4 inhibition | + | 0.5099 | 50.99% |
| CYP2C9 inhibition | + | 0.6137 | 61.37% |
| CYP2C19 inhibition | + | 0.9009 | 90.09% |
| CYP2D6 inhibition | - | 0.8085 | 80.85% |
| CYP1A2 inhibition | + | 0.8965 | 89.65% |
| CYP2C8 inhibition | + | 0.5837 | 58.37% |
| CYP inhibitory promiscuity | + | 0.7635 | 76.35% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.7642 | 76.42% |
| Carcinogenicity (trinary) | Non-required | 0.6112 | 61.12% |
| Eye corrosion | - | 0.9492 | 94.92% |
| Eye irritation | + | 0.6185 | 61.85% |
| Skin irritation | - | 0.6390 | 63.90% |
| Skin corrosion | - | 0.9639 | 96.39% |
| Ames mutagenesis | - | 0.9600 | 96.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4032 | 40.32% |
| Micronuclear | + | 0.6700 | 67.00% |
| Hepatotoxicity | - | 0.7678 | 76.78% |
| skin sensitisation | - | 0.7776 | 77.76% |
| Respiratory toxicity | - | 0.9444 | 94.44% |
| Reproductive toxicity | + | 0.6667 | 66.67% |
| Mitochondrial toxicity | - | 0.8125 | 81.25% |
| Nephrotoxicity | - | 0.7533 | 75.33% |
| Acute Oral Toxicity (c) | III | 0.6654 | 66.54% |
| Estrogen receptor binding | + | 0.8506 | 85.06% |
| Androgen receptor binding | + | 0.7684 | 76.84% |
| Thyroid receptor binding | + | 0.6925 | 69.25% |
| Glucocorticoid receptor binding | + | 0.7326 | 73.26% |
| Aromatase binding | + | 0.5347 | 53.47% |
| PPAR gamma | + | 0.8127 | 81.27% |
| Honey bee toxicity | - | 0.9410 | 94.10% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5355 | 53.55% |
| Fish aquatic toxicity | + | 0.9872 | 98.72% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 |
70901 nM 257 nM |
IC50 IC50 |
PMID: 19327990
via CMAUP |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase |
800 nM 5200 nM 800 nM |
IC50 IC50 IC50 |
via CMAUP
via CMAUP via Super-PRED |
| CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
41500 nM 41495404.26 nM |
IC50 IC50 |
PMID: 19908853
PMID: 23398362 |
| CHEMBL289 | P10635 | Cytochrome P450 2D6 |
600 nM 599791.08 nM |
IC50 IC50 |
PMID: 22206869
PMID: 25871261 |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 |
900 nM 900 nM |
EC50 EC50 |
via Super-PRED
via CMAUP |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 |
6000 nM |
IC50 |
PMID: 19128055
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.14% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.34% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.52% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 93.42% | 90.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.81% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.62% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.42% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.43% | 90.00% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 82.93% | 80.78% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.72% | 89.62% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.63% | 95.50% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.45% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Curcuma longa |
| PubChem | 6474893 |
| NPASS | NPC224814 |
| ChEMBL | CHEMBL128729 |
| LOTUS | LTS0117555 |
| wikiData | Q105119552 |