13-Hydroxy-5-(2-hydroxyacetyl)-5,12-dimethyl-10,14-dioxapentacyclo[11.2.2.11,9.02,7.012,18]octadec-7-en-11-one
Internal ID | 56d9297e-be0d-4ca8-a408-ef76aac82bed |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | 13-hydroxy-5-(2-hydroxyacetyl)-5,12-dimethyl-10,14-dioxapentacyclo[11.2.2.11,9.02,7.012,18]octadec-7-en-11-one |
SMILES (Canonical) | CC1(CCC2C(=CC3C4C25CCC(C4(C(=O)O3)C)(OC5)O)C1)C(=O)CO |
SMILES (Isomeric) | CC1(CCC2C(=CC3C4C25CCC(C4(C(=O)O3)C)(OC5)O)C1)C(=O)CO |
InChI | InChI=1S/C20H26O6/c1-17(14(22)9-21)4-3-12-11(8-17)7-13-15-18(2,16(23)26-13)20(24)6-5-19(12,15)10-25-20/h7,12-13,15,21,24H,3-6,8-10H2,1-2H3 |
InChI Key | YKOCFEFYIFARIO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H26O6 |
Molecular Weight | 362.40 g/mol |
Exact Mass | 362.17293854 g/mol |
Topological Polar Surface Area (TPSA) | 93.10 Ų |
XlogP | 0.40 |
There are no found synonyms. |
![2D Structure of 13-Hydroxy-5-(2-hydroxyacetyl)-5,12-dimethyl-10,14-dioxapentacyclo[11.2.2.11,9.02,7.012,18]octadec-7-en-11-one 2D Structure of 13-Hydroxy-5-(2-hydroxyacetyl)-5,12-dimethyl-10,14-dioxapentacyclo[11.2.2.11,9.02,7.012,18]octadec-7-en-11-one](https://plantaedb.com/storage/docs/compounds/2023/11/1ded0950-8532-11ee-a99d-473ee1c5ec07.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.58% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.48% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.41% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.16% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.93% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.86% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.36% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.75% | 95.56% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.47% | 82.69% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.42% | 86.33% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.31% | 93.04% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.26% | 94.80% |
CHEMBL2581 | P07339 | Cathepsin D | 81.45% | 98.95% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.35% | 97.28% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.68% | 94.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.64% | 99.23% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.21% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona coriacea |
PubChem | 4868249 |
LOTUS | LTS0225825 |
wikiData | Q105349799 |