3-[4,5-Dihydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one
Internal ID | 5a83f4ea-0853-4281-9ee2-34e100c39968 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 3-[4,5-dihydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C(=C4)O)O)O)OC5C(C(C(CO5)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C(=C4)O)O)O)OC5C(C(C(CO5)O)O)O)O)O |
InChI | InChI=1S/C26H28O16/c1-7-16(32)20(36)24(42-25-21(37)18(34)13(31)6-38-25)26(39-7)41-23-19(35)15-10(28)4-9(27)5-14(15)40-22(23)8-2-11(29)17(33)12(30)3-8/h2-5,7,13,16,18,20-21,24-34,36-37H,6H2,1H3 |
InChI Key | SMSLFVKERUHQMM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H28O16 |
Molecular Weight | 596.50 g/mol |
Exact Mass | 596.13773480 g/mol |
Topological Polar Surface Area (TPSA) | 266.00 Ų |
XlogP | -1.00 |
There are no found synonyms. |
![2D Structure of 3-[4,5-Dihydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one 2D Structure of 3-[4,5-Dihydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/1d73a260-853e-11ee-8610-4d06a3df01b2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.82% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.20% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.48% | 89.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 96.12% | 95.64% |
CHEMBL2581 | P07339 | Cathepsin D | 95.68% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.26% | 94.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 94.34% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.74% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.15% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.78% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.65% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.26% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.45% | 90.00% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 86.30% | 94.42% |
CHEMBL3194 | P02766 | Transthyretin | 85.01% | 90.71% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 84.90% | 80.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.46% | 99.23% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 83.62% | 91.38% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.40% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.39% | 99.17% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.69% | 92.94% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.11% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.37% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Moquilea pyrifolia |
Syzygium jambos |
PubChem | 74978299 |
LOTUS | LTS0121560 |
wikiData | Q105256149 |