3-oxo-3-[[3,4,5-trihydroxy-6-[[7-hydroxy-3-[3,4,5-trihydroxy-6-[3-[3-hydroxy-4-[3,4,5-trihydroxy-6-[3-[4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyloxymethyl]oxan-2-yl]oxyphenyl]prop-2-enoyloxymethyl]oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)-2H-chromen-5-yl]oxy]oxan-2-yl]methoxy]propanoic acid
Internal ID | e71367c6-884f-4d3e-aa74-f2fcbbb4ee34 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid 3-O-p-coumaroyl glycosides |
IUPAC Name | 3-oxo-3-[[3,4,5-trihydroxy-6-[[7-hydroxy-3-[3,4,5-trihydroxy-6-[3-[3-hydroxy-4-[3,4,5-trihydroxy-6-[3-[4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyloxymethyl]oxan-2-yl]oxyphenyl]prop-2-enoyloxymethyl]oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)-2H-chromen-5-yl]oxy]oxan-2-yl]methoxy]propanoic acid |
SMILES (Canonical) | C1=CC(=C(C=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=C(C=C(C=C3)C=CC(=O)OCC4C(C(C(C(O4)OC5=CC6=C(C=C(C=C6OC7C(C(C(C(O7)COC(=O)CC(=O)O)O)O)O)O)OC5C8=CC(=C(C(=C8)O)O)O)O)O)O)O)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=C(C=C(C=C3)C=CC(=O)OCC4C(C(C(C(O4)OC5=CC6=C(C=C(C=C6OC7C(C(C(C(O7)COC(=O)CC(=O)O)O)O)O)O)OC5C8=CC(=C(C(=C8)O)O)O)O)O)O)O)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)O |
InChI | InChI=1S/C60H66O36/c61-17-35-44(73)48(77)52(81)59(93-35)91-33-10-22(1-5-26(33)63)4-8-41(70)86-18-36-45(74)49(78)53(82)57(94-36)89-30-6-2-21(9-27(30)64)3-7-40(69)85-19-37-46(75)51(80)55(84)60(96-37)92-34-15-25-31(88-56(34)23-11-28(65)43(72)29(66)12-23)13-24(62)14-32(25)90-58-54(83)50(79)47(76)38(95-58)20-87-42(71)16-39(67)68/h1-15,35-38,44-66,72-84H,16-20H2,(H,67,68) |
InChI Key | LYILUNJOHHVUOO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C60H66O36 |
Molecular Weight | 1363.10 g/mol |
Exact Mass | 1362.3333784 g/mol |
Topological Polar Surface Area (TPSA) | 584.00 Ų |
XlogP | -3.20 |
There are no found synonyms. |
![2D Structure of 3-oxo-3-[[3,4,5-trihydroxy-6-[[7-hydroxy-3-[3,4,5-trihydroxy-6-[3-[3-hydroxy-4-[3,4,5-trihydroxy-6-[3-[4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyloxymethyl]oxan-2-yl]oxyphenyl]prop-2-enoyloxymethyl]oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)-2H-chromen-5-yl]oxy]oxan-2-yl]methoxy]propanoic acid 2D Structure of 3-oxo-3-[[3,4,5-trihydroxy-6-[[7-hydroxy-3-[3,4,5-trihydroxy-6-[3-[3-hydroxy-4-[3,4,5-trihydroxy-6-[3-[4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyloxymethyl]oxan-2-yl]oxyphenyl]prop-2-enoyloxymethyl]oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)-2H-chromen-5-yl]oxy]oxan-2-yl]methoxy]propanoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/1d6884d0-83c9-11ee-94b0-992206a2c1b2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.67% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.52% | 91.49% |
CHEMBL3194 | P02766 | Transthyretin | 97.12% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.10% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.10% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.06% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.72% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.85% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.89% | 99.15% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.69% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.71% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.21% | 95.89% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 84.92% | 95.64% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.45% | 94.73% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.22% | 90.17% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 82.87% | 83.00% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.52% | 85.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.50% | 94.33% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.18% | 95.50% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.34% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Evolvulus nuttallianus |
PubChem | 162933876 |
LOTUS | LTS0241579 |
wikiData | Q105159346 |