[(6S,8R,11R,12S,14R,15S,16R)-6-benzamido-15-[(1S)-1-(dimethylamino)ethyl]-7,7,12,16-tetramethyl-14-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3-dienyl] acetate
Internal ID | ee1947d9-16fd-43f8-9084-f86cb7704047 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | [(6S,8R,11R,12S,14R,15S,16R)-6-benzamido-15-[(1S)-1-(dimethylamino)ethyl]-7,7,12,16-tetramethyl-14-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3-dienyl] acetate |
SMILES (Canonical) | CC(C1C(CC2(C1(CC=C3C2CCC4C(=CCC(C4(C)C)NC(=O)C5=CC=CC=C5)C3)C)C)OC(=O)C)N(C)C |
SMILES (Isomeric) | C[C@@H]([C@H]1[C@@H](C[C@@]2([C@@]1(CC=C3[C@H]2CC[C@@H]4C(=CC[C@@H](C4(C)C)NC(=O)C5=CC=CC=C5)C3)C)C)OC(=O)C)N(C)C |
InChI | InChI=1S/C35H50N2O3/c1-22(37(7)8)31-29(40-23(2)38)21-35(6)28-16-15-27-25(20-26(28)18-19-34(31,35)5)14-17-30(33(27,3)4)36-32(39)24-12-10-9-11-13-24/h9-14,18,22,27-31H,15-17,19-21H2,1-8H3,(H,36,39)/t22-,27+,28+,29+,30-,31-,34+,35-/m0/s1 |
InChI Key | MWRHXXJGCFEZJP-JMVPJNHPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H50N2O3 |
Molecular Weight | 546.80 g/mol |
Exact Mass | 546.38214346 g/mol |
Topological Polar Surface Area (TPSA) | 58.60 Ų |
XlogP | 6.70 |
There are no found synonyms. |
![2D Structure of [(6S,8R,11R,12S,14R,15S,16R)-6-benzamido-15-[(1S)-1-(dimethylamino)ethyl]-7,7,12,16-tetramethyl-14-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3-dienyl] acetate 2D Structure of [(6S,8R,11R,12S,14R,15S,16R)-6-benzamido-15-[(1S)-1-(dimethylamino)ethyl]-7,7,12,16-tetramethyl-14-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3-dienyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/1d509610-8677-11ee-bbd3-0fe875705be9.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.34% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.80% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.58% | 90.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.15% | 91.11% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 91.54% | 94.62% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 90.43% | 94.08% |
CHEMBL2581 | P07339 | Cathepsin D | 90.35% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.39% | 95.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.25% | 91.19% |
CHEMBL5028 | O14672 | ADAM10 | 88.90% | 97.50% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 87.68% | 94.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.91% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.07% | 99.23% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.38% | 93.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.97% | 95.89% |
CHEMBL4072 | P07858 | Cathepsin B | 82.51% | 93.67% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.34% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.31% | 97.14% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.16% | 96.47% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.03% | 89.67% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 82.03% | 94.97% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 81.86% | 91.65% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.33% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Buxus sempervirens |
PubChem | 14286097 |
LOTUS | LTS0166697 |
wikiData | Q105173744 |