5,6,7-Trihydroxy-2-(4-hydroxyphenyl)-3-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one
Internal ID | d28c6f5c-b536-4726-b783-619b09f850e9 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 5,6,7-trihydroxy-2-(4-hydroxyphenyl)-3-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=C(C3=O)C(=C(C(=C4)O)O)O)C5=CC=C(C=C5)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=C(C3=O)C(=C(C(=C4)O)O)O)C5=CC=C(C=C5)O)O)O)O)O)O)O |
InChI | InChI=1S/C27H30O16/c1-8-15(30)20(35)22(37)26(40-8)39-7-13-17(32)21(36)23(38)27(42-13)43-25-19(34)14-12(6-11(29)16(31)18(14)33)41-24(25)9-2-4-10(28)5-3-9/h2-6,8,13,15,17,20-23,26-33,35-38H,7H2,1H3 |
InChI Key | QYRJNVCANQPMCH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O16 |
Molecular Weight | 610.50 g/mol |
Exact Mass | 610.15338487 g/mol |
Topological Polar Surface Area (TPSA) | 266.00 Ų |
XlogP | -1.30 |
There are no found synonyms. |
![2D Structure of 5,6,7-Trihydroxy-2-(4-hydroxyphenyl)-3-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one 2D Structure of 5,6,7-Trihydroxy-2-(4-hydroxyphenyl)-3-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/1d398f30-853a-11ee-80b5-5367f776c6ab.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.51% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.21% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.77% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.41% | 89.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 96.38% | 95.64% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.38% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.18% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.92% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.73% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.42% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.85% | 99.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.58% | 91.49% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.49% | 95.89% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.79% | 95.78% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.23% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.81% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.78% | 94.45% |
CHEMBL3194 | P02766 | Transthyretin | 82.38% | 90.71% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.95% | 97.36% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.93% | 95.89% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.84% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Daphniphyllum calycinum |
PubChem | 74978457 |
LOTUS | LTS0191935 |
wikiData | Q105230355 |