17-(6-hydroxy-6-methylhept-4-en-2-yl)-4,4,9,13,14-pentamethyl-2,8,10,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,7-dione
Internal ID | 17f82537-2855-4fa2-9bb6-9b68d892916a |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
IUPAC Name | 17-(6-hydroxy-6-methylhept-4-en-2-yl)-4,4,9,13,14-pentamethyl-2,8,10,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,7-dione |
SMILES (Canonical) | CC(CC=CC(C)(C)O)C1CCC2(C1(CCC3(C2C(=O)C=C4C3CCC(=O)C4(C)C)C)C)C |
SMILES (Isomeric) | CC(CC=CC(C)(C)O)C1CCC2(C1(CCC3(C2C(=O)C=C4C3CCC(=O)C4(C)C)C)C)C |
InChI | InChI=1S/C30H46O3/c1-19(10-9-14-26(2,3)33)20-13-15-30(8)25-23(31)18-22-21(11-12-24(32)27(22,4)5)28(25,6)16-17-29(20,30)7/h9,14,18-21,25,33H,10-13,15-17H2,1-8H3 |
InChI Key | PFROKAUESVZIJA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H46O3 |
Molecular Weight | 454.70 g/mol |
Exact Mass | 454.34469533 g/mol |
Topological Polar Surface Area (TPSA) | 54.40 Ų |
XlogP | 6.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.87% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.39% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.28% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.05% | 98.95% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 91.92% | 94.78% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.75% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.68% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.31% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.55% | 100.00% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 83.71% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.32% | 93.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.99% | 91.07% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.93% | 96.38% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.54% | 94.45% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.81% | 90.17% |
CHEMBL1977 | P11473 | Vitamin D receptor | 81.33% | 99.43% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.75% | 98.33% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.69% | 100.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.64% | 85.14% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.62% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.31% | 90.71% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.12% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Momordica charantia |
PubChem | 73236887 |
LOTUS | LTS0053493 |
wikiData | Q105207931 |