[(1R,3R,8R,9R,10S,12R)-3-ethoxy-6,9,10-trimethyl-5-oxo-4,11-dioxatetracyclo[7.5.0.03,7.010,12]tetradec-6-en-8-yl] 2-methylprop-2-enoate
Internal ID | ebec53d3-d2c7-46cb-bcb2-ac316f928046 |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | [(1R,3R,8R,9R,10S,12R)-3-ethoxy-6,9,10-trimethyl-5-oxo-4,11-dioxatetracyclo[7.5.0.03,7.010,12]tetradec-6-en-8-yl] 2-methylprop-2-enoate |
SMILES (Canonical) | CCOC12CC3CCC4C(C3(C(C1=C(C(=O)O2)C)OC(=O)C(=C)C)C)(O4)C |
SMILES (Isomeric) | CCO[C@@]12C[C@H]3CC[C@@H]4[C@]([C@]3([C@H](C1=C(C(=O)O2)C)OC(=O)C(=C)C)C)(O4)C |
InChI | InChI=1S/C21H28O6/c1-7-24-21-10-13-8-9-14-20(6,26-14)19(13,5)16(25-17(22)11(2)3)15(21)12(4)18(23)27-21/h13-14,16H,2,7-10H2,1,3-6H3/t13-,14-,16+,19-,20-,21-/m1/s1 |
InChI Key | GJIDPWBARSOWCZ-PDOGPFKTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H28O6 |
Molecular Weight | 376.40 g/mol |
Exact Mass | 376.18858861 g/mol |
Topological Polar Surface Area (TPSA) | 74.40 Ų |
XlogP | 2.50 |
There are no found synonyms. |
![2D Structure of [(1R,3R,8R,9R,10S,12R)-3-ethoxy-6,9,10-trimethyl-5-oxo-4,11-dioxatetracyclo[7.5.0.03,7.010,12]tetradec-6-en-8-yl] 2-methylprop-2-enoate 2D Structure of [(1R,3R,8R,9R,10S,12R)-3-ethoxy-6,9,10-trimethyl-5-oxo-4,11-dioxatetracyclo[7.5.0.03,7.010,12]tetradec-6-en-8-yl] 2-methylprop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/1d04e0f0-84ed-11ee-bbfe-59bbf57b0c2d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.23% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.01% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.19% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 86.79% | 98.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.54% | 91.19% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.29% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.69% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.10% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.59% | 94.45% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.30% | 92.62% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.77% | 97.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.11% | 94.73% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.09% | 100.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.47% | 93.03% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.05% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ligularia virgaurea |
PubChem | 163038533 |
LOTUS | LTS0146981 |
wikiData | Q105009416 |