5,6-dihydroxy-2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one
Internal ID | bd0acf34-5a80-4222-8707-cc6e6ee50c79 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5,6-dihydroxy-2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(C(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(C(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C28H32O15/c1-10-19(30)23(34)25(36)27(40-10)39-9-17-21(32)24(35)26(37)28(43-17)42-16-8-15-18(22(33)20(16)31)13(29)7-14(41-15)11-3-5-12(38-2)6-4-11/h3-8,10,17,19,21,23-28,30-37H,9H2,1-2H3/t10-,17+,19-,21+,23+,24-,25-,26+,27+,28+/m0/s1 |
InChI Key | OKVABSGDPIQROZ-KUECHZNESA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O15 |
Molecular Weight | 608.50 g/mol |
Exact Mass | 608.17412031 g/mol |
Topological Polar Surface Area (TPSA) | 234.00 Ų |
XlogP | -0.80 |
There are no found synonyms. |
![2D Structure of 5,6-dihydroxy-2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one 2D Structure of 5,6-dihydroxy-2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/1c978cc0-8602-11ee-a476-f121566c8a2e.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.53% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 98.39% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.67% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 97.52% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.76% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 94.46% | 86.92% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.19% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.65% | 96.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.62% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.12% | 91.49% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.43% | 97.36% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.18% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.86% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.46% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.39% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.58% | 95.89% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 85.51% | 81.11% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.00% | 96.21% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.79% | 97.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.27% | 90.71% |
CHEMBL1907 | P15144 | Aminopeptidase N | 82.03% | 93.31% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.07% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Teucridium parvifolium |
PubChem | 162963345 |
LOTUS | LTS0127976 |
wikiData | Q105193784 |