6-[[8a-[5-Acetyloxy-6-methyl-3,4-bis[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxycarbonyl-4-carboxy-2,8-dihydroxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4-dihydroxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxane-2-carboxylic acid
| Internal ID | 7e1f232f-92a6-430a-ac12-cf0ce79f600e |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
| IUPAC Name | 6-[[8a-[5-acetyloxy-6-methyl-3,4-bis[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxycarbonyl-4-carboxy-2,8-dihydroxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4-dihydroxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxane-2-carboxylic acid |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3C(CC4(C(C3(C)C(=O)O)CCC5(C4CC=C6C5(CC(C7(C6CC(CC7)(C)C)C(=O)OC8C(C(C(C(O8)C)OC(=O)C)OC9C(C(C(C(O9)C)O)O)O)OC1C(C(C(C(O1)C)O)O)O)O)C)C)C)O)C(=O)O)O)O)O)O)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3C(CC4(C(C3(C)C(=O)O)CCC5(C4CC=C6C5(CC(C7(C6CC(CC7)(C)C)C(=O)OC8C(C(C(C(O8)C)OC(=O)C)OC9C(C(C(C(O9)C)O)O)O)OC1C(C(C(C(O1)C)O)O)O)O)C)C)C)O)C(=O)O)O)O)O)O)O |
| InChI | InChI=1S/C62H96O30/c1-21-32(66)35(69)40(74)50(82-21)88-45-39(73)38(72)44(49(77)78)87-53(45)91-48-28(64)19-58(8)29-13-12-26-27-18-57(6,7)16-17-62(27,31(65)20-60(26,10)59(29,9)15-14-30(58)61(48,11)55(79)80)56(81)92-54-47(90-52-42(76)37(71)34(68)23(3)84-52)46(43(24(4)85-54)86-25(5)63)89-51-41(75)36(70)33(67)22(2)83-51/h12,21-24,27-48,50-54,64-76H,13-20H2,1-11H3,(H,77,78)(H,79,80) |
| InChI Key | GDMHQAWNMFIIFV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C62H96O30 |
| Molecular Weight | 1321.40 g/mol |
| Exact Mass | 1320.59864164 g/mol |
| Topological Polar Surface Area (TPSA) | 473.00 Ų |
| XlogP | -0.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.65% | 91.11% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 94.83% | 97.36% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.13% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.08% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.83% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.38% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.01% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.91% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.86% | 100.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.46% | 85.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.26% | 91.19% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.17% | 96.77% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.06% | 93.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.45% | 94.75% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 83.21% | 87.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.04% | 95.89% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 83.03% | 81.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.90% | 99.23% |
| CHEMBL2820 | P03951 | Coagulation factor XI | 82.54% | 95.29% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.14% | 94.00% |
| CHEMBL5028 | O14672 | ADAM10 | 81.51% | 97.50% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.45% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Herniaria fontanesii |
| PubChem | 162886550 |
| LOTUS | LTS0071456 |
| wikiData | Q105006807 |