2-[[(10S,11R,12R,13S,15R)-13-[2-[(14R,15S,19S)-14-[(10R,11R)-3,4,5,17,18,19-hexahydroxy-8,14-dioxo-11-(3,4,5-trihydroxybenzoyl)oxy-9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-10-yl]-2,3,4,7,8,9-hexahydroxy-12,17-dioxo-13,16-dioxatetracyclo[13.3.1.05,18.06,11]nonadeca-1,3,5(18),6,8,10-hexaen-19-yl]-3,4,5-trihydroxybenzoyl]oxy-3,4,5,11,12,22,23-heptahydroxy-8,18-dioxo-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-21-yl]oxy]-3,4,5-trihydroxybenzoic acid
Internal ID | 97a9ffee-26b6-4b24-b3b8-1e304a6f838c |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 2-[[(10S,11R,12R,13S,15R)-13-[2-[(14R,15S,19S)-14-[(10R,11R)-3,4,5,17,18,19-hexahydroxy-8,14-dioxo-11-(3,4,5-trihydroxybenzoyl)oxy-9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-10-yl]-2,3,4,7,8,9-hexahydroxy-12,17-dioxo-13,16-dioxatetracyclo[13.3.1.05,18.06,11]nonadeca-1,3,5(18),6,8,10-hexaen-19-yl]-3,4,5-trihydroxybenzoyl]oxy-3,4,5,11,12,22,23-heptahydroxy-8,18-dioxo-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-21-yl]oxy]-3,4,5-trihydroxybenzoic acid |
SMILES (Canonical) | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3C4C5C(OC(=O)C6=CC(=C(C(=C6C7=C(C4=C(C(=C7O)O)O)C(=O)O5)O)O)O)C8C(COC(=O)C9=CC(=C(C(=C9C2=C(C(=C(C=C2C(=O)O8)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O1)OC1=C(C(=C(C=C1C(=O)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC(=O)C3=CC(=C(C(=C3[C@@H]4[C@H]5[C@@H](OC(=O)C6=CC(=C(C(=C6C7=C(C4=C(C(=C7O)O)O)C(=O)O5)O)O)O)[C@H]8[C@@H](COC(=O)C9=CC(=C(C(=C9C2=C(C(=C(C=C2C(=O)O8)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O1)OC1=C(C(=C(C=C1C(=O)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C75H52O48/c76-20-1-12(2-21(77)41(20)84)67(106)117-30-11-115-68(107)13-3-22(78)42(85)49(92)31(13)32-15(5-24(80)43(86)50(32)93)71(110)120-63(30)65-64-39(38-40(74(113)121-64)37(55(98)57(100)56(38)99)35-16(72(111)122-65)6-25(81)45(88)52(35)95)36-17(7-26(82)46(89)53(36)96)73(112)123-75-60(103)59(102)62-29(118-75)10-114-69(108)18-9-28(116-61-19(66(104)105)8-27(83)47(90)58(61)101)48(91)54(97)34(18)33-14(70(109)119-62)4-23(79)44(87)51(33)94/h1-9,29-30,39,59-60,62-65,75-103H,10-11H2,(H,104,105)/t29-,30-,39+,59-,60-,62-,63-,64+,65+,75+/m1/s1 |
InChI Key | BVIDHDDVWCBYDM-ZIWHIWHVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C75H52O48 |
Molecular Weight | 1721.20 g/mol |
Exact Mass | 1720.1628034 g/mol |
Topological Polar Surface Area (TPSA) | 833.00 Ų |
XlogP | 2.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.19% | 91.11% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 97.96% | 95.17% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 96.86% | 83.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.36% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.27% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.54% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.51% | 99.17% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 94.50% | 96.38% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.49% | 99.23% |
CHEMBL2535 | P11166 | Glucose transporter | 92.63% | 98.75% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 92.08% | 95.78% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 91.78% | 94.42% |
CHEMBL3194 | P02766 | Transthyretin | 90.85% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.95% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.55% | 95.56% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.32% | 97.21% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.08% | 89.00% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 88.36% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.37% | 95.89% |
CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 84.27% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 84.26% | 98.95% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 83.67% | 95.56% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 82.34% | 83.57% |
CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 81.78% | 95.71% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.65% | 91.71% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.54% | 92.62% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 80.75% | 96.00% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 80.65% | 97.31% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.53% | 90.00% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 80.06% | 97.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Elaeagnus umbellata |
PubChem | 16145408 |
LOTUS | LTS0056005 |
wikiData | Q104946585 |