[3,4,5-Trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] 3,7-dimethylocta-2,6-dienoate
| Internal ID | cf12ec1a-8698-45f9-8045-9c7f1ebd1fa9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
| IUPAC Name | [3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] 3,7-dimethylocta-2,6-dienoate |
| SMILES (Canonical) | CC(=CCCC(=CC(=O)OC1C(C(C(C(O1)COC2C(C(C(C(O2)CO)O)O)O)O)O)O)C)C |
| SMILES (Isomeric) | CC(=CCCC(=CC(=O)OC1C(C(C(C(O1)COC2C(C(C(C(O2)CO)O)O)O)O)O)O)C)C |
| InChI | InChI=1S/C22H36O12/c1-10(2)5-4-6-11(3)7-14(24)34-22-20(30)18(28)16(26)13(33-22)9-31-21-19(29)17(27)15(25)12(8-23)32-21/h5,7,12-13,15-23,25-30H,4,6,8-9H2,1-3H3 |
| InChI Key | HRICDPKQYMFUNE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H36O12 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.22067658 g/mol |
| Topological Polar Surface Area (TPSA) | 196.00 Ų |
| XlogP | -0.90 |
| There are no found synonyms. |
![2D Structure of [3,4,5-Trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] 3,7-dimethylocta-2,6-dienoate](https://plantaedb.com/storage/docs/compounds/2023/11/1bf9df00-8758-11ee-828c-339b417d4a0a.jpg "2D Structure of [3,4,5-Trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] 3,7-dimethylocta-2,6-dienoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.98% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.21% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.63% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.99% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.38% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.27% | 98.95% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 85.70% | 91.24% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.06% | 92.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.60% | 96.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.51% | 94.33% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.12% | 82.50% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.77% | 96.47% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.18% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gardenia jasminoides |
| PubChem | 162989993 |
| LOTUS | LTS0126589 |
| wikiData | Q105032672 |