[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(4-hydroxy-3-methoxybenzoyl)oxymethyl]oxan-2-yl]oxyphenoxy]oxan-2-yl]methyl 4-hydroxy-3-methoxybenzoate
Internal ID | 75ebf061-244b-4a4e-a9a6-7de11c67b2af |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(4-hydroxy-3-methoxybenzoyl)oxymethyl]oxan-2-yl]oxyphenoxy]oxan-2-yl]methyl 4-hydroxy-3-methoxybenzoate |
SMILES (Canonical) | COC1=C(C=CC(=C1)C(=O)OCC2C(C(C(C(O2)OC3=CC(=C(C=C3)OC4C(C(C(C(O4)COC(=O)C5=CC(=C(C=C5)O)OC)O)O)O)OC)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)COC(=O)C5=CC(=C(C=C5)O)OC)O)O)O)OC)O)O)O)O |
InChI | InChI=1S/C35H40O19/c1-46-21-10-15(4-7-18(21)36)32(44)49-13-24-26(38)28(40)30(42)34(53-24)51-17-6-9-20(23(12-17)48-3)52-35-31(43)29(41)27(39)25(54-35)14-50-33(45)16-5-8-19(37)22(11-16)47-2/h4-12,24-31,34-43H,13-14H2,1-3H3/t24-,25-,26-,27-,28+,29+,30-,31-,34-,35-/m1/s1 |
InChI Key | OXAZIKWPCMOVJF-NVAOVSHISA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H40O19 |
Molecular Weight | 764.70 g/mol |
Exact Mass | 764.21637904 g/mol |
Topological Polar Surface Area (TPSA) | 279.00 Ų |
XlogP | 0.20 |
There are no found synonyms. |
![2D Structure of [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(4-hydroxy-3-methoxybenzoyl)oxymethyl]oxan-2-yl]oxyphenoxy]oxan-2-yl]methyl 4-hydroxy-3-methoxybenzoate 2D Structure of [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(4-hydroxy-3-methoxybenzoyl)oxymethyl]oxan-2-yl]oxyphenoxy]oxan-2-yl]methyl 4-hydroxy-3-methoxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/1bf461f0-880c-11ee-8e55-71c947aca550.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.67% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.18% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.03% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 93.76% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.75% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.67% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.54% | 94.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 88.14% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.06% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.02% | 95.89% |
CHEMBL3194 | P02766 | Transthyretin | 88.01% | 90.71% |
CHEMBL2535 | P11166 | Glucose transporter | 84.61% | 98.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.44% | 94.73% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.89% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.78% | 89.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.60% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ehretia matthewii |
PubChem | 101928786 |
LOTUS | LTS0127510 |
wikiData | Q105202463 |