1Beta,3Beta-Dihydroxyfriedelane
Internal ID | 4fc7fd18-e9ad-4d63-bda6-e5e667fd1b28 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1R,3S,4R,4aR,6aS,6aS,6bR,8aR,12aR,14aR,14bS)-4,4a,6a,6b,8a,11,11,14a-octamethyl-1,2,3,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-hexadecahydropicene-1,3-diol |
SMILES (Canonical) | CC1C(CC(C2C1(CCC3C2(CCC4(C3(CCC5(C4CC(CC5)(C)C)C)C)C)C)C)O)O |
SMILES (Isomeric) | C[C@H]1[C@H](C[C@H]([C@@H]2[C@@]1(CC[C@H]3[C@]2(CC[C@@]4([C@@]3(CC[C@@]5([C@H]4CC(CC5)(C)C)C)C)C)C)C)O)O |
InChI | InChI=1S/C30H52O2/c1-19-20(31)17-21(32)24-27(19,5)10-9-22-28(24,6)14-16-30(8)23-18-25(2,3)11-12-26(23,4)13-15-29(22,30)7/h19-24,31-32H,9-18H2,1-8H3/t19-,20-,21+,22-,23+,24+,26+,27+,28+,29+,30-/m0/s1 |
InChI Key | QBUHMHYOJMSWCT-GQDZGCLGSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H52O2 |
Molecular Weight | 444.70 g/mol |
Exact Mass | 444.396730897 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 9.10 |
CHEMBL1641909 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 94.10% | 82.69% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.80% | 90.17% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.66% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.63% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.92% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.74% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.35% | 96.09% |
CHEMBL204 | P00734 | Thrombin | 89.23% | 96.01% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 88.87% | 97.31% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.85% | 92.94% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.02% | 96.38% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.19% | 91.03% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 85.37% | 97.64% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.91% | 100.00% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 83.62% | 91.38% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 82.92% | 89.05% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.62% | 95.89% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 80.74% | 92.98% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.36% | 95.38% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 80.00% | 98.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Garcia parviflora |
PubChem | 50900237 |
NPASS | NPC469987 |
ChEMBL | CHEMBL1641909 |
LOTUS | LTS0249951 |
wikiData | Q105218009 |