[(1S,2R,3S,4R,5R,6S)-2,5-dihydroxy-4-(2-methylbut-2-enoyloxy)-6-[(Z)-2-methylbut-2-enoyl]oxy-3-(2-methylpropoxy)cyclohexyl] 2-methylbut-2-enoate
| Internal ID | 31b994c9-6ca8-4182-aed7-2bff43943ab8 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tricarboxylic acids and derivatives |
| IUPAC Name | [(1S,2R,3S,4R,5R,6S)-2,5-dihydroxy-4-(2-methylbut-2-enoyloxy)-6-[(Z)-2-methylbut-2-enoyl]oxy-3-(2-methylpropoxy)cyclohexyl] 2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OC1C(C(C(C(C1OC(=O)C(=CC)C)O)OC(=O)C(=CC)C)OCC(C)C)O |
| SMILES (Isomeric) | CC=C(C)C(=O)O[C@H]1[C@@H]([C@@H]([C@@H]([C@H]([C@@H]1OC(=O)/C(=C\C)/C)O)OC(=O)C(=CC)C)OCC(C)C)O |
| InChI | InChI=1S/C25H38O9/c1-9-14(6)23(28)32-20-18(27)22(34-25(30)16(8)11-3)21(33-24(29)15(7)10-2)17(26)19(20)31-12-13(4)5/h9-11,13,17-22,26-27H,12H2,1-8H3/b14-9?,15-10?,16-11-/t17-,18-,19+,20-,21+,22+/m1/s1 |
| InChI Key | WGUCBRBCJOYAQR-DHSKOCMCSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C25H38O9 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.25158279 g/mol |
| Topological Polar Surface Area (TPSA) | 129.00 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.84% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.20% | 98.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.77% | 97.21% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.13% | 96.95% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.48% | 89.34% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.02% | 90.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.21% | 91.11% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 84.98% | 95.93% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.58% | 99.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.00% | 96.47% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 83.24% | 97.47% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.98% | 94.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.51% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.88% | 94.45% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.79% | 98.75% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.28% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Inula cappa |
| PubChem | 162818866 |
| LOTUS | LTS0179202 |
| wikiData | Q105304957 |