[(3S,4R,5R,6S)-4,5-dihydroxy-6-[[(3S,6R,8S,11R,12S,15S,16R,19S,21R)-19-hydroxy-3,7,7,11,16,20,20-heptamethyl-8-pentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-enyl]oxy]oxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate
| Internal ID | 3c396375-dda2-47f9-83ba-848c0ab968e5 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | [(3S,4R,5R,6S)-4,5-dihydroxy-6-[[(3S,6R,8S,11R,12S,15S,16R,19S,21R)-19-hydroxy-3,7,7,11,16,20,20-heptamethyl-8-pentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-enyl]oxy]oxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES (Canonical) | CC1(C2CCC3(CC4=CCC5C(C(CCC5(C4CCC3C2(CCC1OC6C(C(C(CO6)OC(=O)C=CC7=CC=C(C=C7)O)O)O)C)C)O)(C)C)C)C |
| SMILES (Isomeric) | C[C@@]12CC[C@@H]3[C@@]([C@H]1CC[C@H]4C(=CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O)C)C2)(CC[C@@H](C3(C)C)O[C@H]6[C@@H]([C@H]([C@H](CO6)OC(=O)/C=C/C7=CC=C(C=C7)O)O)O)C |
| InChI | InChI=1S/C44H64O8/c1-40(2)31-15-11-27-24-42(5)21-18-32-41(3,4)35(20-23-44(32,7)33(42)16-14-29(27)43(31,6)22-19-34(40)46)52-39-38(49)37(48)30(25-50-39)51-36(47)17-10-26-8-12-28(45)13-9-26/h8-13,17,29-35,37-39,45-46,48-49H,14-16,18-25H2,1-7H3/b17-10+/t29-,30-,31-,32-,33-,34-,35-,37-,38+,39-,42-,43+,44-/m0/s1 |
| InChI Key | YZQIFKLWKKIFBP-CIUKDSHMSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C44H64O8 |
| Molecular Weight | 721.00 g/mol |
| Exact Mass | 720.46011900 g/mol |
| Topological Polar Surface Area (TPSA) | 126.00 Ų |
| XlogP | 8.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.15% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.24% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.64% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.57% | 96.09% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 92.84% | 89.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.32% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.85% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.67% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.52% | 95.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.13% | 90.17% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 87.63% | 95.92% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.90% | 98.95% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 86.51% | 97.33% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 85.33% | 89.44% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.20% | 97.28% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.03% | 93.99% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 82.90% | 85.31% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 82.38% | 98.35% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.22% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.20% | 100.00% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 81.40% | 85.49% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.26% | 92.94% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.64% | 99.17% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 80.49% | 83.57% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.05% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lycopodiella inundata |
| PubChem | 163194848 |
| LOTUS | LTS0075459 |
| wikiData | Q105369399 |