(2R,3R)-10-hydroxy-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-5,8-dimethoxy-2,3-dihydro-[1,4]dioxino[2,3-c]xanthen-7-one
Internal ID | e6a8f674-4cc0-4093-8950-69152e99e516 |
Taxonomy | Organoheterocyclic compounds > Benzodioxanes > Phenylbenzodioxanes > Phenylbenzo-1,4-dioxanes |
IUPAC Name | (2R,3R)-10-hydroxy-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-5,8-dimethoxy-2,3-dihydro-[1,4]dioxino[2,3-c]xanthen-7-one |
SMILES (Canonical) | COC1=CC(=CC2=C1C(=O)C3=CC(=C4C(=C3O2)OC(C(O4)C5=CC(=C(C=C5)O)OC)CO)OC)O |
SMILES (Isomeric) | COC1=CC(=CC2=C1C(=O)C3=CC(=C4C(=C3O2)O[C@@H]([C@H](O4)C5=CC(=C(C=C5)O)OC)CO)OC)O |
InChI | InChI=1S/C25H22O10/c1-30-15-6-11(4-5-14(15)28)22-19(10-26)34-25-23-13(9-18(32-3)24(25)35-22)21(29)20-16(31-2)7-12(27)8-17(20)33-23/h4-9,19,22,26-28H,10H2,1-3H3/t19-,22-/m1/s1 |
InChI Key | WPQPZXDSZHOTDQ-DENIHFKCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H22O10 |
Molecular Weight | 482.40 g/mol |
Exact Mass | 482.12129689 g/mol |
Topological Polar Surface Area (TPSA) | 133.00 Ų |
XlogP | 2.80 |
There are no found synonyms. |
![2D Structure of (2R,3R)-10-hydroxy-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-5,8-dimethoxy-2,3-dihydro-[1,4]dioxino[2,3-c]xanthen-7-one 2D Structure of (2R,3R)-10-hydroxy-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-5,8-dimethoxy-2,3-dihydro-[1,4]dioxino[2,3-c]xanthen-7-one](https://plantaedb.com/storage/docs/compounds/2023/11/1b7498b0-8633-11ee-a480-43453536725a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.49% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.67% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.86% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.35% | 94.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.07% | 86.92% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.92% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.92% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 90.63% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.54% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.84% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.82% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.79% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.27% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 83.81% | 90.71% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.70% | 92.62% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.11% | 99.15% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.13% | 95.89% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.08% | 80.78% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.01% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Calophyllum austroindicum |
PubChem | 101989187 |
LOTUS | LTS0225961 |
wikiData | Q105310143 |