(1R,2R,4S,9S,10S,13S,15S,16R)-2,15,16-trihydroxy-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-6-one
Internal ID | 0702e867-b1c6-4b3a-8c01-3bfd7afb18bc |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | (1R,2R,4S,9S,10S,13S,15S,16R)-2,15,16-trihydroxy-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-6-one |
SMILES (Canonical) | CC1(C2CC(C34C(C2(CCC1=O)C)CCC(C3O)C(=C)C4O)O)C |
SMILES (Isomeric) | C[C@@]12CCC(=O)C([C@H]1C[C@H]([C@]34[C@H]2CC[C@H]([C@H]3O)C(=C)[C@@H]4O)O)(C)C |
InChI | InChI=1S/C20H30O4/c1-10-11-5-6-12-19(4)8-7-14(21)18(2,3)13(19)9-15(22)20(12,16(10)23)17(11)24/h11-13,15-17,22-24H,1,5-9H2,2-4H3/t11-,12-,13+,15+,16-,17+,19-,20-/m0/s1 |
InChI Key | NTFFIALEDUMPAM-OHMGPRHDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H30O4 |
Molecular Weight | 334.40 g/mol |
Exact Mass | 334.21440943 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | 1.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.59% | 94.75% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 92.76% | 96.38% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.21% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.97% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.78% | 90.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.76% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 83.70% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.68% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.54% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.19% | 91.11% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 82.02% | 95.38% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.01% | 96.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.62% | 82.69% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.52% | 95.89% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.24% | 85.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.03% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon japonicus |
PubChem | 162842245 |
LOTUS | LTS0178130 |
wikiData | Q105185414 |