(2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-6-hydroxy-2-(hydroxymethyl)-4-[(1S,2R,3'S,4S,5'R,6S,7S,8R,9S,12R,13R,16S)-3'-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]oxy-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 39ab5241-6de9-488f-bc6a-2572ebc0f7bd |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-6-hydroxy-2-(hydroxymethyl)-4-[(1S,2R,3'S,4S,5'R,6S,7S,8R,9S,12R,13R,16S)-3'-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]oxy-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CC(C2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(OC(C7OC8C(C(C(C(O8)C)O)O)O)O)CO)OC9C(C(C(C(O9)C)O)O)O)C)C)C)NC1)O |
SMILES (Isomeric) | C[C@@H]1C[C@@H]([C@@]2([C@H]([C@H]3[C@@H](O2)C[C@H]4[C@@]3(CC[C@@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H](O[C@H]([C@@H]7O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)O)CO)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)C)C)C)NC1)O |
InChI | InChI=1S/C45H73NO16/c1-18-13-29(48)45(46-16-18)19(2)30-27(62-45)15-26-24-8-7-22-14-23(9-11-43(22,5)25(24)10-12-44(26,30)6)58-38-37(60-41-35(53)33(51)31(49)20(3)56-41)28(17-47)59-40(55)39(38)61-42-36(54)34(52)32(50)21(4)57-42/h7,18-21,23-42,46-55H,8-17H2,1-6H3/t18-,19+,20+,21+,23+,24-,25-,26-,27+,28-,29+,30+,31+,32+,33-,34-,35-,36-,37-,38+,39-,40-,41+,42+,43+,44+,45+/m1/s1 |
InChI Key | HXGPJVFMLZBAHJ-GDYFTDKESA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H73NO16 |
Molecular Weight | 884.10 g/mol |
Exact Mass | 883.49293524 g/mol |
Topological Polar Surface Area (TPSA) | 259.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.00% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.94% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.18% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.27% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.89% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.74% | 97.25% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 91.66% | 89.05% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.15% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.32% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.26% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.83% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.79% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.74% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.82% | 86.33% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.41% | 91.71% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.12% | 94.75% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.57% | 96.61% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.17% | 96.43% |
CHEMBL2581 | P07339 | Cathepsin D | 82.11% | 98.95% |
CHEMBL237 | P41145 | Kappa opioid receptor | 81.96% | 98.10% |
CHEMBL233 | P35372 | Mu opioid receptor | 81.21% | 97.93% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.15% | 95.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.19% | 95.50% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.16% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum donianum |
PubChem | 162935695 |
LOTUS | LTS0155766 |
wikiData | Q105034993 |